![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[SND]](/icons/sound2.gif) | 67135_KaraSquare-OM-DRY.flac | 2023-09-19 11:31 | 6.1M | |
![[SND]](/icons/sound2.gif) | 67135_KaraSquare-OM-FX.flac | 2023-09-19 11:31 | 6.4M | |
![[SND]](/icons/sound2.gif) | 67135_KaraSquare-OM-Reverb.flac | 2023-09-19 11:31 | 6.5M | |
![[SND]](/icons/sound2.gif) | 67136_Kara Square - Ara Kara 432 hz (MixterPlus) DRY.flac | 2023-09-19 12:02 | 6.9M | |
![[SND]](/icons/sound2.gif) | 67136_Kara Square - Ara Kara 432 hz (MixterPlus) FX.flac | 2023-09-19 11:58 | 7.4M | |
![[SND]](/icons/sound2.gif) | 67136_Kara Square - Ara Kara 432 hz (MixterPlus) Reverb.flac | 2023-09-19 12:02 | 7.5M | |
![[SND]](/icons/sound2.gif) | 67137_Kara Square - Ahh 432 hz (MixterPlus) DRY.flac | 2023-09-19 12:24 | 8.1M | |
![[SND]](/icons/sound2.gif) | 67137_Kara Square - Ahh 432 hz (MixterPlus) FX.flac | 2023-09-19 12:24 | 8.6M | |
![[SND]](/icons/sound2.gif) | 67137_Kara Square - Ahh 432 hz (MixterPlus) Reverb.flac | 2023-09-19 12:24 | 8.7M | |
![[SND]](/icons/sound2.gif) | 67159_Kara Square - MixterPlus Podcast Bumpers.flac | 2023-09-23 18:19 | 776K | |
![[SND]](/icons/sound2.gif) | 67303_Kara Square - Invocation for Peace (feat. AuntBeast, SackJo22, Piero Peluche).flac | 2023-10-20 18:40 | 19M | |
![[SND]](/icons/sound2.gif) | 67596_Kara Square - The Beauty of This Time of Year VOCAL dry.flac | 2023-12-21 23:28 | 14M | |
![[SND]](/icons/sound2.gif) | 67596_Kara Square - The Beauty of This Time of Year VOCAL with FX.flac | 2023-12-21 23:28 | 15M | |
![[SND]](/icons/sound2.gif) | 67597_Kara Square - Jingle Bells - Backup VOX FX.flac | 2023-12-21 23:43 | 2.7M | |
![[SND]](/icons/sound2.gif) | 67597_Kara Square - Jingle Bells - Backup VOX dry.flac | 2023-12-21 23:43 | 2.6M | |
![[SND]](/icons/sound2.gif) | 67597_Kara Square - Jingle Bells - Main Vox DRY.flac | 2023-12-21 23:43 | 8.8M | |
![[SND]](/icons/sound2.gif) | 67597_Kara Square - Jingle Bells - Main Vox with FX.flac | 2023-12-21 23:43 | 8.9M | |
![[SND]](/icons/sound2.gif) | 67601_Elf Festival (Apoxode Vocals Elf-ified).flac | 2023-12-22 21:38 | 3.5M | |
![[SND]](/icons/sound2.gif) | 67601_Elf Festival (feat Apoxode) - Kara Square.flac | 2023-12-22 21:38 | 9.6M | |
![[SND]](/icons/sound2.gif) | 67646_Harmonica - Auld Lang Syne - Kara Square.flac | 2023-12-31 20:24 | 13M | |
![[SND]](/icons/sound2.gif) | 67646_Vocal (Extra Verse) - Auld Lang Syne - Kara Square.flac | 2023-12-31 20:24 | 3.1M | |
![[SND]](/icons/sound2.gif) | 67646_Vocal - Auld Lang Syne - Kara Square.flac | 2023-12-31 20:24 | 22M | |
![[SND]](/icons/sound2.gif) | 67659_Banjolele DRY.flac | 2024-01-02 19:04 | 18M | |
![[SND]](/icons/sound2.gif) | 67659_Banjolele with FX.flac | 2024-01-02 19:04 | 20M | |
![[SND]](/icons/sound2.gif) | 67659_Kara Low Vocal DRY.flac | 2024-01-02 19:03 | 2.4M | |
![[SND]](/icons/sound2.gif) | 67659_Kara Low Vocal with FX.flac | 2024-01-02 19:03 | 2.8M | |
![[SND]](/icons/sound2.gif) | 67659_Kara Main Vocal DRY.flac | 2024-01-02 19:03 | 11M | |
![[SND]](/icons/sound2.gif) | 67659_Kara Main Vocal with FX.flac | 2024-01-02 19:03 | 12M | |
![[SND]](/icons/sound2.gif) | 67659_Resolutionary - mwic and Kara Square.flac | 2024-01-02 19:03 | 42M | |
![[SND]](/icons/sound2.gif) | 68008_Kara Square - When the Bones Are Dry (Acoustic Guitar).flac | 2024-03-29 13:59 | 11M | |
![[SND]](/icons/sound2.gif) | 68008_Kara Square - When the Bones Are Dry (Vocals).flac | 2024-03-29 13:59 | 8.1M | |
![[SND]](/icons/sound2.gif) | 68009_Kara Square - Run (Banjo).flac | 2024-03-29 14:32 | 125K | |
![[SND]](/icons/sound2.gif) | 68009_Kara Square - Run (Flute).flac | 2024-03-29 14:32 | 1.8M | |
![[SND]](/icons/sound2.gif) | 68009_Kara Square - Run (Vibes).flac | 2024-03-29 14:32 | 100K | |
![[SND]](/icons/sound2.gif) | 68009_Kara Square - Run (Vocal Double).flac | 2024-03-29 14:31 | 3.2M | |
![[SND]](/icons/sound2.gif) | 68009_Kara Square - Run (Vocal High).flac | 2024-03-29 14:31 | 2.5M | |
![[SND]](/icons/sound2.gif) | 68009_Kara Square - Run (Vocal Main).flac | 2024-03-29 14:31 | 3.6M | |
![[SND]](/icons/sound2.gif) | 68009_Kara Square - Run (Vocal SFX Breath).flac | 2024-03-29 14:32 | 1.7M | |
![[SND]](/icons/sound2.gif) | 68010_Kara Square - Enemy (Backup Vox).flac | 2024-03-29 14:59 | 3.0M | |
![[SND]](/icons/sound2.gif) | 68010_Kara Square - Enemy (Backup Vox OooAhh).flac | 2024-03-29 14:59 | 1.2M | |
![[SND]](/icons/sound2.gif) | 68010_Kara Square - Enemy (Backup Vox Sounds).flac | 2024-03-29 14:59 | 1.4M | |
![[SND]](/icons/sound2.gif) | 68010_Kara Square - Enemy (Main Vox).flac | 2024-03-29 14:59 | 4.2M | |
![[SND]](/icons/sound2.gif) | 68238_Kara Square - Four Horsemen (feat Admiral Bob, Speck, Apoxode).flac | 2024-05-23 14:32 | 31M | |
![[SND]](/icons/sound2.gif) | 68238_Kara Square - Four Horsemen (feat Lyrics by Admiral Bob) VOX FX.flac | 2024-05-23 14:33 | 16M | |
![[SND]](/icons/sound2.gif) | 68238_Kara Square - Four Horsemen (feat Lyrics by Admiral Bob) VOX dry.flac | 2024-05-23 14:33 | 7.1M | |
![[SND]](/icons/sound2.gif) | 68615_Backup Vox DRY.flac | 2024-07-26 14:27 | 5.5M | |
![[SND]](/icons/sound2.gif) | 68615_Backup Vox FX.flac | 2024-07-26 14:27 | 5.7M | |
![[SND]](/icons/sound2.gif) | 68615_Main Vox DRY.flac | 2024-07-26 14:27 | 18M | |
![[SND]](/icons/sound2.gif) | 68615_Ukulele DRY.flac | 2024-07-26 14:28 | 27M | |
![[SND]](/icons/sound2.gif) | 68615_Ukulele FX.flac | 2024-07-26 14:28 | 27M | |
![[SND]](/icons/sound2.gif) | 69174_Kara Square - Santa MUST WEAR BLACK.flac | 2024-12-06 21:58 | 26M | |
![[SND]](/icons/sound2.gif) | 69623_Cajon High (with Snare Wire Snap).flac | 2025-04-04 13:26 | 391K | |
![[SND]](/icons/sound2.gif) | 69623_Cajon Low.flac | 2025-04-04 13:26 | 424K | |
![[SND]](/icons/sound2.gif) | 69623_Udu (Ibo) & Cajon Drums.flac | 2025-04-04 13:25 | 2.4M | |
![[SND]](/icons/sound2.gif) | 69623_Udu (Ibo) Bottom Snap.flac | 2025-04-04 13:26 | 540K | |
![[SND]](/icons/sound2.gif) | 69623_Udu (Ibo) Hand.flac | 2025-04-04 13:26 | 1.3M | |
![[SND]](/icons/sound2.gif) | 69623_Udu (Ibo) Side Hole.flac | 2025-04-04 13:25 | 930K | |
![[SND]](/icons/sound2.gif) | 69623_Udu (Ibo) Top Hole.flac | 2025-04-04 13:26 | 847K | |
![[SND]](/icons/sound2.gif) | 69684_Kara Square - We Can Have It All - Ukulele DRY.flac | 2025-04-23 15:34 | 4.8M | |
![[SND]](/icons/sound2.gif) | 69684_Kara Square - We Can Have It All - Vocal 1 DRY.flac | 2025-04-23 15:35 | 7.6M | |
![[SND]](/icons/sound2.gif) | 69684_Kara Square - We Can Have It All - Vocal 2 DRY.flac | 2025-04-23 15:35 | 7.6M | |
![[SND]](/icons/sound2.gif) | 69684_Kara Square - We Can Have It All - Vocal 3 DRY.flac | 2025-04-23 15:36 | 7.6M | |
![[SND]](/icons/sound2.gif) | 69684_Kara Square - We Can Have It All - Vocal 4 DRY.flac | 2025-04-23 15:36 | 7.5M | |
![[SND]](/icons/sound2.gif) | 69684_Kara Square - We Can Have It All.flac | 2025-04-23 15:34 | 24M | |
![[SND]](/icons/sound2.gif) | 70379_Bridge of Light by Kara Square (Lyrics by Javolenus) DRY.flac | 2025-12-17 22:21 | 2.8M | |
![[SND]](/icons/sound2.gif) | 70379_Bridge of Light by Kara Square (Lyrics by Javolenus) FX.flac | 2025-12-17 22:22 | 3.1M | |
![[SND]](/icons/sound2.gif) | 70379_Bridge of Light by Kara Square (feat Javolenus, Apoxode).flac | 2025-12-17 22:21 | 9.9M | |
![[SND]](/icons/sound2.gif) | 70471_Kara Square - When We're Gone - Harmony Vox.wav | 2026-01-09 17:22 | 24M | |
![[SND]](/icons/sound2.gif) | 70471_Kara Square - When We're Gone - High Vox.wav | 2026-01-09 17:23 | 24M | |
![[SND]](/icons/sound2.gif) | 70471_Kara Square - When We're Gone - Low Vox.wav | 2026-01-09 17:23 | 24M | |
![[SND]](/icons/sound2.gif) | 70471_Kara Square - When We're Gone - Main Vox.wav | 2026-01-09 17:22 | 24M | |
![[SND]](/icons/sound2.gif) | 1694632934_KaraSquare-OM-FX.mp3 | 2023-09-13 19:22 | 2.2M | |
![[SND]](/icons/sound2.gif) | 1695122940_KaraSquare-OM-FX.mp3 | 2023-09-19 11:29 | 2.2M | |
![[SND]](/icons/sound2.gif) | 1695124662_Kara Square - Ara Kara 432 hz (MixterPlus) FX.mp3 | 2023-09-19 11:57 | 2.2M | |
![[SND]](/icons/sound2.gif) | 1695126213_Kara Square - Ahh 432 hz (MixterPlus) FX.mp3 | 2023-09-19 12:23 | 2.5M | |
![[SND]](/icons/sound2.gif) | 1695312472_Kara Square - MixterPlus Podcast Bumpers.mp3 | 2023-09-21 16:07 | 388K | |
![[SND]](/icons/sound2.gif) | 1695312605_Kara Square - MixterPlus Podcast Bumpers.mp3 | 2023-09-21 16:10 | 388K | |
![[SND]](/icons/sound2.gif) | 1695315948_Kara Square - MixterPlus Podcast Bumpers.mp3 | 2023-09-21 17:05 | 388K | |
![[SND]](/icons/sound2.gif) | 1695316056_Kara Square - MixterPlus Podcast Bumpers.mp3 | 2023-09-21 17:07 | 388K | |
![[SND]](/icons/sound2.gif) | 1695329995_Kara Square - MixterPlus Podcast Bumpers.mp3 | 2023-09-21 20:59 | 388K | |
![[SND]](/icons/sound2.gif) | 1695330100_Kara Square - MixterPlus Podcast Bumpers.mp3 | 2023-09-21 21:01 | 388K | |
![[SND]](/icons/sound2.gif) | 1695330177_Kara Square - MixterPlus Podcast Bumpers.mp3 | 2023-09-21 21:02 | 388K | |
![[SND]](/icons/sound2.gif) | 1695334427_Kara Square - MixterPlus Podcast Bumpers.mp3 | 2023-09-21 22:13 | 388K | |
![[SND]](/icons/sound2.gif) | 1695492929_Kara Square - MixterPlus Podcast Bumpers.mp3 | 2023-09-23 18:15 | 388K | |
![[SND]](/icons/sound2.gif) | 1703201981_Kara Square - Jingle Bells VOCAL DEMO.mp3 | 2023-12-21 23:39 | 2.8M | |
![[SND]](/icons/sound2.gif) | 1704054062_Auld Lang Syne - Kara Parts Preview.mp3 | 2023-12-31 20:21 | 6.2M | |
![[SND]](/icons/sound2.gif) | 1711720667_Kara Square - When the Bones Are Dry (Preview).mp3 | 2024-03-29 13:57 | 6.7M | |
![[SND]](/icons/sound2.gif) | 1711722329_Kara Square - Run (Vocal Preview).mp3 | 2024-03-29 14:25 | 4.1M | |
![[SND]](/icons/sound2.gif) | 1711724004_Kara Square - Enemy (Preview).mp3 | 2024-03-29 14:53 | 3.5M | |
![[SND]](/icons/sound2.gif) | 1722003809_All Life Is Love (Preview) - Kara Square.mp3 | 2024-07-26 14:23 | 7.3M | |
![[SND]](/icons/sound2.gif) | 1722028555_Interview with Snowflake and So Sha - Reduced Background Noise.mp3 | 2024-07-26 21:15 | 19M | |
![[SND]](/icons/sound2.gif) | 1733522056_Kara Square - Santa MUST WEAR BLACK.mp3 | 2024-12-06 21:54 | 7.3M | |
![[SND]](/icons/sound2.gif) | 1743772920_Udu (Ibo) & Cajon Drums.mp3 | 2025-04-04 13:22 | 473K | |
![[SND]](/icons/sound2.gif) | 1745422087_Kara Square - We Can Have It All.mp3 | 2025-04-23 15:28 | 3.1M | |
![[SND]](/icons/sound2.gif) | 1767978958_Kara Square - When We're Gone - Vocal Preview.mp3 | 2026-01-09 17:15 | 3.7M | |
![[SND]](/icons/sound2.gif) | 1777589402_Kara Square - Mourning Dreams (feat Javolenus, Piero Peluche).mp3 | 2026-04-30 22:50 | 2.3M | |
![[SND]](/icons/sound2.gif) | 1777589457_Kara Square - Mourning Dreams (Vocals DRY).flac | 2026-04-30 22:50 | 4.5M | |
![[SND]](/icons/sound2.gif) | 1777589457_Kara Square - Mourning Dreams (Vocals with FX).flac | 2026-04-30 22:50 | 5.7M | |
![[SND]](/icons/sound2.gif) | 1777589457_Kara Square - Mourning Dreams (feat Javolenus, Piero Peluche).flac | 2026-04-30 22:50 | 15M | |
![[SND]](/icons/sound2.gif) | BridgeofLightbyKaraSquarefeatJavolenusApoxode.mp3 | 2025-12-17 22:20 | 2.0M | |
![[SND]](/icons/sound2.gif) | Elf Festival (feat Apoxode) - Kara Square.mp3 | 2023-12-22 21:37 | 1.4M | |
![[IMG]](/icons/image2.gif) | KS-scull93.jpg | 2013-09-12 22:12 | 21K | |
![[IMG]](/icons/image2.gif) | Kara-Square-BLK9393x94.jpg | 2016-05-09 20:47 | 27K | |
![[IMG]](/icons/image2.gif) | Kara-Square-BLK9393x9420x20.jpg | 2016-06-27 04:12 | 22K | |
![[IMG]](/icons/image2.gif) | Kara-Square9393x94.jpg | 2015-11-20 03:56 | 33K | |
![[SND]](/icons/sound2.gif) | Kara Square - A Wide Realm of Wild Reality (feat Apoxode, Lord Byron).mp3 | 2023-05-16 19:42 | 3.9M | |
![[SND]](/icons/sound2.gif) | Kara Square - Invocation for Peace (feat. AuntBeast, SackJo22, Piero Peluche).mp3 | 2023-10-20 18:38 | 3.0M | |
![[SND]](/icons/sound2.gif) | KaraSquare-OM-FX.mp3 | 2023-09-13 18:53 | 2.2M | |
![[SND]](/icons/sound2.gif) | Kara Square - OM 136-1 hz DRY.flac | 2023-09-07 19:37 | 6.1M | |
![[SND]](/icons/sound2.gif) | Kara Square - OM 136-1 hz FX.flac | 2023-09-07 19:37 | 6.4M | |
![[SND]](/icons/sound2.gif) | Kara Square - OM 136-1 hz Reverb.flac | 2023-09-07 19:37 | 6.5M | |
![[SND]](/icons/sound2.gif) | Kara Square - OM 136.1 hz (MixterPlus) DRY.flac | 2023-09-07 17:14 | 6.1M | |
![[SND]](/icons/sound2.gif) | Kara Square - OM 136.1 hz (MixterPlus) FX.flac | 2023-09-07 17:14 | 6.4M | |
![[SND]](/icons/sound2.gif) | Kara Square - OM 136.1 hz (MixterPlus) Reverb.flac | 2023-09-07 17:14 | 6.5M | |
![[SND]](/icons/sound2.gif) | Kara Square - The Beauty of This Time of Year (featuring Unreal_DM).mp3 | 2023-12-21 23:27 | 4.0M | |
![[SND]](/icons/sound2.gif) | KaraSquareFourHorsemenfeatAdmiralBobSpeckApoxode.mp3 | 2024-05-23 14:30 | 3.9M | |
![[IMG]](/icons/image2.gif) | MMT-by_Chris-Smallwood.jpg | 2013-10-18 18:38 | 20K | |
![[ ]](/icons/unknown.gif) | MixterPlus - 1. Dark 2. Light by mwic.mp3 | 2026-01-08 14:18 | 2.8M | |
![[ ]](/icons/unknown.gif) | MixterPlus - 2001: A Space Odyssey (Thus Sprach Zarathustra) by Zenboy1955.mp3 | 2024-09-17 19:45 | 1.0M | |
![[ ]](/icons/unknown.gif) | MixterPlus - 2025 (In The Shadow Of A Star) by Speck.mp3 | 2026-01-08 14:18 | 7.1M | |
![[ ]](/icons/unknown.gif) | MixterPlus - 2025 (ineffectual whinging redux) by Speck.mp3 | 2026-01-08 14:18 | 6.5M | |
![[ ]](/icons/unknown.gif) | MixterPlus - A Bonny Reel Under The Winter Stars by Zenboy1955.mp3 | 2024-12-27 11:32 | 3.4M | |
![[ ]](/icons/unknown.gif) | MixterPlus - A Connection To Essence by Speck.mp3 | 2024-12-27 11:32 | 6.7M | |
![[ ]](/icons/unknown.gif) | MixterPlus - A Heart At The Clock Of The Universe (feat. Darkroom) by Ben Blohowiak.mp3 | 2024-09-17 19:45 | 5.6M | |
![[ ]](/icons/unknown.gif) | MixterPlus - A Riddle To Set You Right (Early Reflections mix) by Speck.mp3 | 2024-11-13 15:31 | 6.3M | |
![[ ]](/icons/unknown.gif) | MixterPlus - A Shadowy School Of Gelatinous Fish by Speck.mp3 | 2026-02-10 20:55 | 7.7M | |
![[ ]](/icons/unknown.gif) | MixterPlus - A Tender Universe by Speck.mp3 | 2026-01-08 14:18 | 8.5M | |
![[ ]](/icons/unknown.gif) | MixterPlus - A World Without You by Stefan Kartenberg.mp3 | 2026-02-10 20:55 | 4.0M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Abandoned Cabin by Apoxode.mp3 | 2026-02-10 20:55 | 4.2M | |
![[ ]](/icons/unknown.gif) | MixterPlus - After Secrets, Mysteries (feat. Apoxode) by Ben Blohowiak.mp3 | 2024-08-16 15:11 | 4.0M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Ageing Bones On A Young Heart by Radioontheshelf.mp3 | 2023-11-09 17:13 | 8.9M | |
![[ ]](/icons/unknown.gif) | MixterPlus - All Life Is Love (Zenboy Workshop Mix) by Zenboy1955.mp3 | 2024-08-16 15:11 | 7.3M | |
![[ ]](/icons/unknown.gif) | MixterPlus - All Life is Love Elevate Remix (Ft Kara and Many Mixters) by SackJo22.mp3 | 2024-08-16 15:07 | 12M | |
![[ ]](/icons/unknown.gif) | MixterPlus - All Rise (feat. Admiral Bob and Speck) by Ben Blohowiak.mp3 | 2024-11-13 15:31 | 4.8M | |
![[ ]](/icons/unknown.gif) | MixterPlus - All That Love Is (Ever Was mix) by Speck.mp3 | 2024-09-17 19:45 | 5.0M | |
![[ ]](/icons/unknown.gif) | MixterPlus - All Up In The Admiral's Elev8or by Speck.mp3 | 2024-11-13 15:31 | 7.7M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Amazing Science (ft. Javolenus) by Apoxode.mp3 | 2026-02-10 20:55 | 5.5M | |
![[ ]](/icons/unknown.gif) | MixterPlus - And My Heart Aches (featuring Snowflake) by Speck.mp3 | 2024-06-18 13:38 | 10M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Andante Esportare by Speck.mp3 | 2024-11-13 15:31 | 7.4M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Apoxode Rising by spinningmerkaba.mp3 | 2025-05-30 12:35 | 8.2M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Arnie Needs A Rest by Speck.mp3 | 2026-02-10 20:55 | 6.2M | |
![[ ]](/icons/unknown.gif) | MixterPlus - At The Zombie Rave by Zenboy1955.mp3 | 2023-11-08 19:14 | 5.4M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Auld Lang Syne (Kindness Mix) by Snowflake.mp3 | 2024-01-02 18:42 | 7.6M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Be Free (Imagination Rising Mix) by spinningmerkaba.mp3 | 2025-05-30 12:35 | 4.6M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Berangle Trimuda by Apoxode.mp3 | 2024-01-10 15:00 | 3.6M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Blood Demon (ft. Snowflake) by Apoxode.mp3 | 2023-11-30 20:00 | 4.1M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Blue Jingles by Speck.mp3 | 2024-01-02 18:42 | 3.7M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Bridge Of Light (Cozy mix) by Speck.mp3 | 2026-01-08 14:18 | 7.6M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Bridge of Light by Kara Square.mp3 | 2026-01-08 14:18 | 2.0M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Broceliande (Dance Mix) by Apoxode.mp3 | 2024-08-16 15:07 | 2.7M | |
![[ ]](/icons/unknown.gif) | MixterPlus - By Pale Moonlight by Ben Blohowiak.mp3 | 2023-11-14 14:45 | 3.4M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Calmly by Speck.mp3 | 2026-01-08 14:18 | 9.4M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Carefree (maniacally) by Speck.mp3 | 2026-01-08 14:18 | 8.3M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Cellophane (Melody Demo) by Ben Blohowiak.mp3 | 2023-11-21 17:18 | 3.2M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Chiar(oscuro) (Shadows Follia mix) by Speck.mp3 | 2026-01-08 14:18 | 5.3M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Circle of reasons in seasons by Stefan Kartenberg.mp3 | 2023-12-22 19:05 | 8.0M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Clammy by mwic.mp3 | 2026-01-08 14:18 | 1.9M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Clock The Universe by Speck.mp3 | 2024-11-13 15:31 | 8.2M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Conquistador by Radioontheshelf.mp3 | 2023-12-22 19:05 | 7.0M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Contempl8 by Apoxode.mp3 | 2024-11-13 15:31 | 1.9M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Cozy Up & Coo (feat. SO SHA) by Ben Blohowiak.mp3 | 2026-01-08 14:18 | 4.7M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Cozy Up as Pruu by Stefan Kartenberg.mp3 | 2026-01-08 14:18 | 3.9M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Danse de Cleves + by Stefan Kartenberg.mp3 | 2024-01-02 18:42 | 2.0M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Deep Roots ft Stefan Kartenberg by SackJo22.mp3 | 2024-06-18 13:38 | 9.1M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Don't Fret by mwic.mp3 | 2024-08-16 15:07 | 1.7M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Don't Tread On Me (FAFO) by Michelle Noel.mp3 | 2026-02-10 20:55 | 6.0M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Dream Walking ft. Uta Goebel-Gros by Apoxode.mp3 | 2024-05-23 14:46 | 1.8M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Dwellers in the Darkness by Snowflake.mp3 | 2026-01-08 14:18 | 6.2M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Ecce Advenait (While They Sleep mix) by Speck.mp3 | 2023-12-22 19:05 | 3.8M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Ecce Advenait by Stefan Kartenberg.mp3 | 2023-12-22 19:05 | 1.5M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Ecce Sketche by Zenboy1955.mp3 | 2023-12-22 19:05 | 4.6M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Elev8 The Funk (Remixed with rich Funksauce goodness) by Zenboy1955.mp3 | 2024-08-16 15:07 | 5.7M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Elev8 Your Soul by Admiral Bob.mp3 | 2024-08-16 15:07 | 9.4M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Elev808 by mwic.mp3 | 2024-09-17 19:45 | 3.0M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Elevate Your Heart by SackJo22.mp3 | 2024-11-13 15:31 | 15M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Elf Festival (Better Times mix) by Speck.mp3 | 2023-12-22 19:05 | 3.8M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Elf Festival by Kara Square.mp3 | 2024-01-02 18:42 | 1.4M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Enemy by Stefan Kartenberg.mp3 | 2024-04-18 13:29 | 3.5M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Enigamination by Apoxode.mp3 | 2025-05-30 12:35 | 3.2M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Escape Velocity (Call and Response Mix) by Zenboy1955.mp3 | 2026-01-08 14:18 | 7.1M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Escape Velocity by Stefan Kartenberg.mp3 | 2026-01-08 14:18 | 3.6M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Everybody Elev8 by Speck.mp3 | 2024-11-13 15:31 | 6.1M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Everybody Sharing by Speck.mp3 | 2025-05-30 12:35 | 8.2M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Everyone Knows Where North is feat. Joanna Kowalewska (deeplastik remix) by Deeplastik.mp3 | 2024-06-18 13:38 | 13M | |
![[ ]](/icons/unknown.gif) | MixterPlus - FAFO (Samsara Studio Mix) by Zenboy1955.mp3 | 2026-02-10 20:55 | 8.1M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Fafo by Stefan Kartenberg.mp3 | 2026-02-10 20:55 | 3.6M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Falling Deep (featuring Amy Lloyd) by Speck.mp3 | 2024-05-23 14:46 | 8.4M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Falling Deep Instrumental by Ezra Skull.mp3 | 2024-06-18 13:38 | 6.9M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Falling Deep ft. Amy Lloyd by Ezra Skull.mp3 | 2024-05-31 14:15 | 6.9M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Fooled Around And Found Art by Speck.mp3 | 2026-02-10 20:55 | 6.1M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Forest (First Contact) by Speck.mp3 | 2026-02-10 20:55 | 6.9M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Four Horsemen by Kara Square.mp3 | 2024-05-23 14:46 | 3.9M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Four Horsemen ft. Kara Square by Apoxode.mp3 | 2024-05-31 14:15 | 3.4M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Fret Cafe by Apoxode.mp3 | 2024-08-16 15:07 | 1.7M | |
![[ ]](/icons/unknown.gif) | MixterPlus - From the Darkness by Apoxode.mp3 | 2026-01-08 14:18 | 6.5M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Golden Hour Mood Board (feat. Javolenus) by Ben Blohowiak.mp3 | 2024-08-16 15:11 | 4.1M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Grace Me Guide + by Stefan Kartenberg.mp3 | 2023-12-22 19:05 | 1.8M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Guitar FX Swing by Stefan Kartenberg.mp3 | 2023-12-22 19:05 | 3.4M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Hallelujah by Stefan Kartenberg.mp3 | 2024-01-02 18:42 | 3.5M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Have It All by Stefan Kartenberg.mp3 | 2026-01-08 14:18 | 2.6M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Heartaches (udm) by unreal_dm.mp3 | 2024-05-31 14:15 | 11M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Hexagram 29 : Dark Waters (The Abyss) by SackJo22.mp3 | 2024-01-10 15:00 | 6.6M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Holiday Blues by Admiral Bob.mp3 | 2024-01-02 18:42 | 7.0M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Holiday Resolution by Apoxode.mp3 | 2024-01-10 15:00 | 2.4M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Holiday Rush by Apoxode.mp3 | 2026-01-08 14:18 | 4.6M | |
![[ ]](/icons/unknown.gif) | MixterPlus - I Am Lost (featuring Apoxode) by Speck.mp3 | 2024-05-31 14:15 | 7.5M | |
![[ ]](/icons/unknown.gif) | MixterPlus - ICON by martinsea.mp3 | 2024-04-18 13:29 | 5.0M | |
![[ ]](/icons/unknown.gif) | MixterPlus - I Will Be Free by Radioontheshelf.mp3 | 2024-04-18 13:29 | 13M | |
![[ ]](/icons/unknown.gif) | MixterPlus - I Wish You Well (Holiday Jazz Lounge mix) by Speck.mp3 | 2024-01-02 18:42 | 4.3M | |
![[ ]](/icons/unknown.gif) | MixterPlus - I am Your Icon by martinsea.mp3 | 2024-04-18 13:29 | 4.2M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Icarus, what a guy by Admiral Bob.mp3 | 2026-01-08 14:18 | 8.1M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Jingle Bahlis by Zenboy1955.mp3 | 2024-01-02 18:42 | 5.1M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Jingle Bells (What a fun) by Stefan Kartenberg.mp3 | 2024-01-02 18:42 | 4.5M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Jinglejazz by Speck.mp3 | 2023-12-22 19:05 | 3.4M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Joy - We Will See by Admiral Bob.mp3 | 2024-08-16 15:07 | 7.8M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Just Look (Best Days ZENBOY) by spinningmerkaba.mp3 | 2024-04-18 13:29 | 8.5M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Kara Square and Piero Peluche - All Life Is Love by Piero Peluche.mp3 | 2024-11-13 15:31 | 12M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Kara Square and Piero Peluche - We Can Have It All by Piero Peluche.mp3 | 2025-05-30 12:35 | 7.9M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Keep Dreamin by Stefan Kartenberg.mp3 | 2023-12-22 19:05 | 3.6M | |
![[ ]](/icons/unknown.gif) | MixterPlus - KleinGartenEduelle by Stefan Kartenberg.mp3 | 2023-12-22 19:05 | 4.8M | |
![[ ]](/icons/unknown.gif) | MixterPlus - LID Interlude by mwic.mp3 | 2026-01-08 14:18 | 1.9M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Land of Miracles by Snowflake.mp3 | 2023-12-22 19:05 | 4.0M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Land of Miracles by raja_ffm.mp3 | 2023-12-22 19:05 | 10M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Light's Way by Speck.mp3 | 2026-01-08 14:18 | 6.0M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Light 2023 (ft Stefan Kartenberg) by SackJo22.mp3 | 2023-12-22 19:05 | 4.3M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Light Escapes by Speck.mp3 | 2026-01-08 14:18 | 6.5M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Light by Speck.mp3 | 2023-12-22 19:05 | 4.0M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Linguistic by mwic.mp3 | 2024-08-16 15:07 | 1.7M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Lit candle by Stefan Kartenberg.mp3 | 2026-01-08 14:18 | 1.9M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Look Up by Speck.mp3 | 2024-12-27 11:32 | 11M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Looking Back Into Future (featuring Uta Goebel-Gros) by Speck.mp3 | 2024-05-23 14:46 | 9.1M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Looking Back Into Future ft Uta Goebel Gros by Ezra Skull.mp3 | 2024-06-18 13:38 | 7.5M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Luminous Astraea by Stefan Kartenberg.mp3 | 2026-02-10 20:55 | 3.2M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Makahiki ( Alpine Ski Avalanche Mix ) by Loveshadow.mp3 | 2024-12-27 11:32 | 11M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Makahiki ( Cinematic Big wave Mix ) by Loveshadow.mp3 | 2024-12-27 11:32 | 11M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Makahiki ( Progressive Trance Anthem Mix ) by Loveshadow.mp3 | 2024-12-27 11:32 | 11M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Makahiki ( West Coast December Holiday Mix ) by Loveshadow.mp3 | 2024-12-27 11:32 | 9.5M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Makahiki ,The Signs ( Hardcore Dutch Festival Mix ) by Loveshadow.mp3 | 2024-12-27 11:32 | 8.4M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Makahiki by raja_ffm.mp3 | 2024-12-27 11:32 | 9.7M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Meditation flute by Stefan Kartenberg.mp3 | 2023-12-22 19:05 | 3.7M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Missed Caller by Martijn de Boer (NiGiD).mp3 | 2026-01-08 14:18 | 5.1M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Missed Calls + by Stefan Kartenberg.mp3 | 2023-12-22 19:05 | 3.9M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Mist Crawler by Speck.mp3 | 2026-01-08 14:18 | 6.4M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Molecular Movement by Zenboy1955.mp3 | 2025-05-30 12:35 | 7.3M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Mr. mwic's Talkin' Blues by Zenboy1955.mp3 | 2024-09-17 19:45 | 1.6M | |
![[ ]](/icons/unknown.gif) | MixterPlus - My Heart Aches (Orchestral Mix) by Zenboy1955.mp3 | 2024-05-23 14:46 | 7.5M | |
![[ ]](/icons/unknown.gif) | MixterPlus - My Heart Aches by Snowflake.mp3 | 2024-05-23 14:46 | 5.0M | |
![[ ]](/icons/unknown.gif) | MixterPlus - My Medicine by Snowflake.mp3 | 2024-11-13 15:31 | 4.4M | |
![[ ]](/icons/unknown.gif) | MixterPlus - My blues be bluer by Stefan Kartenberg.mp3 | 2024-03-22 14:31 | 3.6M | |
![[ ]](/icons/unknown.gif) | MixterPlus - No Dystopia (Guitar Stem) by Zenboy1955.mp3 | 2024-11-13 15:31 | 4.5M | |
![[ ]](/icons/unknown.gif) | MixterPlus - No Dystopia (feat. Javolenus) by Ben Blohowiak.mp3 | 2024-09-17 19:45 | 4.5M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Not Afraid by Snowflake.mp3 | 2024-09-17 19:45 | 3.9M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Not Going Back by Snowflake.mp3 | 2024-09-17 19:45 | 3.1M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Not Going Back by raja_ffm.mp3 | 2024-11-13 15:31 | 9.2M | |
![[ ]](/icons/unknown.gif) | MixterPlus - November Dawn's Own Ambience by Speck.mp3 | 2024-11-13 15:31 | 6.2M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Obsidian Sky (A Blackboard Lesson In Time) by Speck.mp3 | 2024-12-27 11:32 | 8.2M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Om Mani Padme Hum by Zenboy1955.mp3 | 2024-11-13 15:31 | 7.7M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Quick Nights w. mwic by Apoxode.mp3 | 2025-05-30 12:35 | 2.5M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Quickly Remix by mwic.mp3 | 2024-11-13 15:31 | 2.9M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Red Book by Stefan Kartenberg.mp3 | 2025-05-30 12:35 | 3.6M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Relit Journey by Speck.mp3 | 2026-01-08 14:18 | 5.5M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Remade (Imagination Rising mix) by Speck.mp3 | 2025-05-30 12:35 | 8.2M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Reset Your Password by Attic Ella.mp3 | 2024-11-13 15:31 | 5.5M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Resolutionary (Probable Outcome Mix) by Zenboy1955.mp3 | 2024-01-10 15:00 | 8.0M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Resolutionary by Kara Square.mp3 | 2024-01-10 15:00 | 5.8M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Resolutionary by Stefan Kartenberg.mp3 | 2024-01-10 15:00 | 4.0M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Rise And Imagine by Speck.mp3 | 2025-05-30 12:35 | 4.2M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Rising by Snowflake.mp3 | 2025-05-30 12:35 | 4.7M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Root Down by spinningmerkaba.mp3 | 2025-01-08 18:38 | 6.8M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Run (feat. Kara Square) by Ben Blohowiak.mp3 | 2024-04-18 13:29 | 3.0M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Run by Stefan Kartenberg.mp3 | 2024-04-18 13:29 | 5.6M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Run by Zenboy1955.mp3 | 2024-04-18 13:29 | 6.1M | |
![[ ]](/icons/unknown.gif) | MixterPlus - SANTA MUST WEAR BLACK ORCHESTRATED by Ant.Survila.mp3 | 2025-01-08 18:38 | 13M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Santa MUST WEAR BLACK (with soundtrack) by Zenboy1955.mp3 | 2024-12-27 11:32 | 8.6M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Shapeshifters (featuring Snowflake) by Speck.mp3 | 2024-05-31 14:15 | 13M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Shapeshifters ft. Madam Snowflake by Apoxode.mp3 | 2024-06-18 13:38 | 1.9M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Shimmering gaslight by Stefan Kartenberg.mp3 | 2026-01-08 14:18 | 3.3M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Shine Again (Spoken Word) by Zenboy1955.mp3 | 2024-12-27 11:32 | 4.5M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Shine Again by Snowflake.mp3 | 2024-12-27 11:32 | 3.3M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Shine On! by Zenboy1955.mp3 | 2026-01-08 14:18 | 5.4M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Silent Night Hallelujah by Snowflake.mp3 | 2023-12-22 19:05 | 3.4M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Six Forty AM (Packed Event mix) by Speck.mp3 | 2026-02-10 20:55 | 6.6M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Skin deep by ScOmBer.mp3 | 2025-05-30 12:35 | 8.7M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Slipping By by Admiral Bob.mp3 | 2026-01-08 14:18 | 5.9M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Soar High by Speck.mp3 | 2026-01-08 14:18 | 5.9M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Solstice, The Lonely Darknesss Of Completion by Speck.mp3 | 2026-01-08 14:18 | 8.6M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Speckle Bells by Zenboy1955.mp3 | 2023-12-22 19:05 | 2.8M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Star Essence by Snowflake.mp3 | 2024-12-27 11:32 | 2.2M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Stardust (feat. AuntBeast) by Ben Blohowiak.mp3 | 2024-03-22 14:31 | 3.6M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Stream by Darkroom.mp3 | 2024-03-15 14:55 | 8.7M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Synchronizing With The Universe by Speck.mp3 | 2025-05-30 12:35 | 7.3M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Talking Texas Turning Blues (udm) mix by unreal_dm.mp3 | 2024-09-17 19:45 | 4.2M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Talking Texas Turning Blues by mwic.mp3 | 2024-09-17 19:45 | 2.4M | |
![[ ]](/icons/unknown.gif) | MixterPlus - The Beauty of This Time of Year by Kara Square.mp3 | 2023-12-22 19:05 | 4.0M | |
![[ ]](/icons/unknown.gif) | MixterPlus - The Clock Strikes 12 by coruscate.mp3 | 2026-02-10 20:55 | 3.1M | |
![[ ]](/icons/unknown.gif) | MixterPlus - The Dust Of Broken Homes by Radioontheshelf.mp3 | 2023-11-09 17:13 | 13M | |
![[ ]](/icons/unknown.gif) | MixterPlus - The Eagle Has Landed - Tara OGrady Dream by SackJo22.mp3 | 2024-05-23 14:46 | 8.7M | |
![[ ]](/icons/unknown.gif) | MixterPlus - The Edge of Life. by Loveshadow.mp3 | 2024-12-27 11:32 | 4.7M | |
![[ ]](/icons/unknown.gif) | MixterPlus - The Healing Tree (Feat. Amina Mara) by Zenboy1955.mp3 | 2024-05-23 14:46 | 7.5M | |
![[ ]](/icons/unknown.gif) | MixterPlus - The Light Comes In (feat. Zenboy1955) by Ben Blohowiak.mp3 | 2025-01-08 18:38 | 4.6M | |
![[ ]](/icons/unknown.gif) | MixterPlus - The Meaning of Christmas by Admiral Bob.mp3 | 2026-01-08 14:18 | 10M | |
![[ ]](/icons/unknown.gif) | MixterPlus - The Return by Ben Blohowiak.mp3 | 2024-11-13 15:31 | 4.5M | |
![[ ]](/icons/unknown.gif) | MixterPlus - There But For by Ben Blohowiak.mp3 | 2023-11-09 17:13 | 3.7M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Thesaurus by coruscate.mp3 | 2026-02-10 20:55 | 3.4M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Things Change by Zenboy1955.mp3 | 2025-05-30 12:35 | 8.5M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Time is Shifting ft Stephanie Burns by SackJo22.mp3 | 2024-06-18 13:38 | 18M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Trips undTräume von einem grünen Land by Stefan Kartenberg.mp3 | 2026-02-10 20:55 | 5.5M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Turning Blue (udm) mix by unreal_dm.mp3 | 2024-09-17 19:45 | 7.9M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Turning Blue by Snowflake.mp3 | 2024-09-17 19:45 | 3.7M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Turning blue by raja_ffm.mp3 | 2024-09-17 19:45 | 9.6M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Two New Sisters by Apoxode.mp3 | 2026-02-10 20:55 | 3.8M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Up From The Cold Dark Ground by Speck.mp3 | 2026-01-08 14:18 | 5.7M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Upending Dystopia (ShuffleDusk mix) by Speck.mp3 | 2024-11-13 15:31 | 6.2M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Uplifting, Unending (feat. SackJo22) by Ben Blohowiak.mp3 | 2024-09-17 19:45 | 5.9M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Uplifting Ending by SackJo22.mp3 | 2023-11-09 17:13 | 3.6M | |
![[ ]](/icons/unknown.gif) | MixterPlus - We're Not Going Back (All Rise mix) by Speck.mp3 | 2024-11-13 15:31 | 8.3M | |
![[ ]](/icons/unknown.gif) | MixterPlus - We Three Kings....Or So They Said! by Radioontheshelf.mp3 | 2023-12-22 19:05 | 9.4M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Welcome Mat (Apoxode rmx) by Apoxode.mp3 | 2024-06-18 13:38 | 1.4M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Welcome Mat by mwic.mp3 | 2024-06-18 13:38 | 2.8M | |
![[ ]](/icons/unknown.gif) | MixterPlus - When The Bones Are Dry (Feat. Kara Square) by Zenboy1955.mp3 | 2024-04-18 13:29 | 6.8M | |
![[ ]](/icons/unknown.gif) | MixterPlus - When We're Gone by Kara Square, Piero Peluche & Maurizio Leonardo Solfietti by Piero Peluche.mp3 | 2026-02-10 20:55 | 7.1M | |
![[ ]](/icons/unknown.gif) | MixterPlus - When We're Gone by Stefan Kartenberg.mp3 | 2026-02-10 20:55 | 2.8M | |
![[ ]](/icons/unknown.gif) | MixterPlus - When the Bones Are Dry by Stefan Kartenberg.mp3 | 2024-04-18 13:29 | 4.5M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Whistling Ambler by Speck.mp3 | 2025-05-30 12:35 | 8.5M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Wishing You Well by Stefan Kartenberg.mp3 | 2023-12-22 19:05 | 4.5M | |
![[ ]](/icons/unknown.gif) | MixterPlus - Xedon by Stefan Kartenberg.mp3 | 2023-11-21 17:18 | 4.4M | |
![[ ]](/icons/unknown.gif) | MixterPlus - You Left by SackJo22.mp3 | 2024-04-18 13:29 | 10M | |
![[ ]](/icons/unknown.gif) | MixterPlus - distantudu by martinsea.mp3 | 2025-05-30 12:35 | 4.3M | |
![[ ]](/icons/unknown.gif) | MixterPlus - here the sun is shining by martinsea.mp3 | 2023-11-21 17:18 | 2.7M | |
![[ ]](/icons/unknown.gif) | MixterPlus - mwicarus by mwic.mp3 | 2026-01-08 14:18 | 3.8M | |
![[ ]](/icons/unknown.gif) | MixterPlus - nine and more by martinsea.mp3 | 2025-05-30 12:35 | 4.0M | |
![[ ]](/icons/unknown.gif) | Mixterplus - Ageing Bones On A Young Heart by Radioontheshelf.mp3 | 2023-11-06 15:55 | 8.9M | |
![[ ]](/icons/unknown.gif) | Mixterplus - The Dust Of Broken Homes by Radioontheshelf.mp3 | 2023-11-06 15:55 | 13M | |
![[ ]](/icons/unknown.gif) | Mixterplus - Uplifting Ending by SackJo22.mp3 | 2023-11-06 15:55 | 3.6M | |
![[SND]](/icons/sound2.gif) | Resolutionary - mwic and Kara Square.mp3 | 2024-01-02 19:02 | 5.8M | |
![[ ]](/icons/unknown.gif) | Vocals DRY from Waking Dream of Life and Light by Kara Square. | 2023-11-07 17:21 | 3.8M | |
![[ ]](/icons/unknown.gif) | Vocals DRY from Waking Dream of Life and Light by Kara Square.flac | 2023-11-07 17:34 | 3.8M | |
![[ ]](/icons/unknown.gif) | Vocals with Nectar EQ from Waking Dream of Life and Light by Kara Square. | 2023-11-07 17:21 | 3.9M | |
![[ ]](/icons/unknown.gif) | Vocals with Nectar EQ from Waking Dream of Life and Light by Kara Square.flac | 2023-11-07 17:34 | 3.9M | |
![[IMG]](/icons/image2.gif) | bannerDrawing.png | 2023-11-07 14:05 | 18K | |
![[ ]](/icons/compressed.gif) | bookmarks20231106.zip | 2023-11-06 15:55 | 23M | |
![[ ]](/icons/compressed.gif) | bookmarks20231107.zip | 2023-11-07 17:34 | 31M | |
![[ ]](/icons/compressed.gif) | bookmarks20231108.zip | 2023-11-08 19:14 | 65M | |
![[ ]](/icons/compressed.gif) | bookmarks20231109.zip | 2023-11-09 17:13 | 26M | |
![[ ]](/icons/compressed.gif) | bookmarks20231114.zip | 2023-11-14 14:45 | 3.3M | |
![[ ]](/icons/compressed.gif) | bookmarks20231121.zip | 2023-11-21 17:18 | 10M | |
![[ ]](/icons/compressed.gif) | bookmarks20231130.zip | 2023-11-30 20:00 | 4.1M | |
![[ ]](/icons/compressed.gif) | bookmarks20231222.zip | 2023-12-22 19:05 | 97M | |
![[ ]](/icons/compressed.gif) | bookmarks20240102.zip | 2024-01-02 18:42 | 39M | |
![[ ]](/icons/compressed.gif) | bookmarks20240110.zip | 2024-01-10 15:00 | 29M | |
![[ ]](/icons/compressed.gif) | bookmarks20240124.zip | 2024-01-24 16:34 | 3.1M | |
![[ ]](/icons/compressed.gif) | bookmarks20240315.zip | 2024-03-15 14:55 | 8.4M | |
![[ ]](/icons/compressed.gif) | bookmarks20240322.zip | 2024-03-22 14:31 | 7.1M | |
![[ ]](/icons/compressed.gif) | bookmarks20240328.zip | 2024-03-28 13:32 | 5.6M | |
![[ ]](/icons/compressed.gif) | bookmarks20240418.zip | 2024-04-18 13:29 | 66M | |
![[ ]](/icons/compressed.gif) | bookmarks20240523.zip | 2024-05-23 14:46 | 47M | |
![[ ]](/icons/compressed.gif) | bookmarks20240531.zip | 2024-05-31 14:15 | 41M | |
![[ ]](/icons/compressed.gif) | bookmarks20240618.zip | 2024-06-18 13:38 | 64M | |
![[ ]](/icons/compressed.gif) | bookmarks20240816.zip | 2024-08-16 15:11 | 15M | |
![[ ]](/icons/compressed.gif) | bookmarks20240917.zip | 2024-09-17 19:45 | 60M | |
![[ ]](/icons/compressed.gif) | bookmarks20241113.zip | 2024-11-13 15:31 | 114M | |
![[ ]](/icons/compressed.gif) | bookmarks20241227.zip | 2024-12-27 11:32 | 111M | |
![[ ]](/icons/compressed.gif) | bookmarks20250108.zip | 2025-01-08 18:38 | 23M | |
![[ ]](/icons/compressed.gif) | bookmarks20250530.zip | 2025-05-30 12:35 | 98M | |
![[ ]](/icons/compressed.gif) | bookmarks20260108.zip | 2026-01-08 14:18 | 179M | |
![[ ]](/icons/compressed.gif) | bookmarks20260210.zip | 2026-02-10 20:55 | 89M | |
![[ ]](/icons/compressed.gif) | bookmarks_20260326_141911.zip | 2026-03-26 14:19 | 14M | |
![[ ]](/icons/compressed.gif) | bookmarks_20260430_150325.zip | 2026-04-30 15:03 | 127M | |
![[ ]](/icons/compressed.gif) | bookmarks_20260513_160629.zip | 2026-05-13 16:06 | 129M | |
![[ ]](/icons/compressed.gif) | bookmarks_20260513_160721.zip | 2026-05-13 16:07 | 129M | |
![[ ]](/icons/compressed.gif) | bookmarks_20260513_160747.zip | 2026-05-13 16:07 | 129M | |
![[IMG]](/icons/image2.gif) | clouds_sm.jpg | 2010-08-27 15:12 | 13K | |
![[ ]](/icons/unknown.gif) | loop 1 from Handcrafted Ambiloop by Apoxode.flac | 2023-11-08 19:14 | 6.7M | |
![[ ]](/icons/unknown.gif) | loop 2 from Handcrafted Ambiloop by Apoxode.flac | 2023-11-08 19:14 | 7.8M | |
![[ ]](/icons/unknown.gif) | loop 3 from Handcrafted Ambiloop by Apoxode.flac | 2023-11-08 19:14 | 6.7M | |
![[ ]](/icons/unknown.gif) | loop 9 from Handcrafted Ambiloop by Apoxode.flac | 2023-11-08 19:14 | 7.9M | |
![[ ]](/icons/unknown.gif) | loop 10 from Handcrafted Ambiloop by Apoxode.flac | 2023-11-08 19:14 | 6.9M | |
![[ ]](/icons/unknown.gif) | loop 11 from Handcrafted Ambiloop by Apoxode.flac | 2023-11-08 19:14 | 8.6M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_4_Vocal_Snippets.mp3 | 2012-05-19 22:01 | 361K | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_4_Vocal_Snippets.svg | 2016-02-08 21:15 | 8.6K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_4_Vocal_Snippets.zip | 2012-05-19 22:00 | 2.2M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_A_Dream_Within_a_Dream.mp3 | 2017-10-10 22:26 | 2.9M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_A_Dream_Within_a_Dream.svg | 2018-01-27 13:36 | 9.0K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_A_Dream_Within_a_Dream_-_Vocals.flac | 2017-10-12 15:05 | 4.3M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_A_Dream_Within_a_Dream_-_Vocals.mp3 | 2017-10-10 22:28 | 2.6M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_A_Dream_Within_a_Dream_-_Vocals.svg | 2018-04-25 14:14 | 8.6K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_A_Dream_Within_a_Dream_-_Vocals_1.flac | 2017-10-10 22:19 | 8.5M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_A_Dream_Within_a_Dream_-_Vocals_2.flac | 2017-10-10 22:19 | 3.8M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_A_Dream_Within_a_Dream_-_Vocals_3.flac | 2017-10-12 15:06 | 2.9M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_A_Heart_With_Your_Name_On_It.mp3 | 2012-06-22 15:23 | 5.5M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_A_Heart_With_Your_Name_On_It.svg | 2016-07-10 18:19 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_A_Heart_With_Your_Name_On_It.zip | 2012-06-01 22:34 | 37M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_A_Moment_of_Clarity.mp3 | 2014-11-01 22:15 | 6.0M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_A_Moment_of_Clarity.svg | 2015-12-23 00:00 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_A_Moment_of_Clarity.zip | 2014-11-04 16:15 | 21M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_A_Moment_of_Clarity_(Vocals).flac | 2016-07-26 17:11 | 10M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_A_Moment_of_Clarity_(Vocals).mp3 | 2015-01-22 19:31 | 4.7M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_A_Moment_of_Clarity_(Vocals).svg | 2021-01-19 22:41 | 8.0K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_A_Moment_of_Clarity_(Vocals).zip | 2014-11-01 22:03 | 21M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_A_Moment_of_Clarity_(Vocals)_1.flac | 2016-07-26 17:11 | 2.8M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_A_Moment_of_Clarity_1.zip | 2014-11-04 17:54 | 34M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_A_Whispered_Joke.mp3 | 2013-04-26 13:42 | 5.7M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_A_Whispered_Joke.svg | 2016-10-01 16:01 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_A_Whispered_Joke_-_Vocals.mp3 | 2013-04-26 13:45 | 5.1M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_A_Whispered_Joke_-_Vocals.svg | 2018-06-10 22:41 | 9.0K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_A_Whispered_Joke_-_Vocals.zip | 2013-04-26 13:29 | 14M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_A_Wide_Realm_of_Wild_Reality_-_Vocals.flac | 2023-05-18 19:49 | 11M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_A_Wide_Realm_of_Wild_Reality_-_Vocals.mp3 | 2023-05-16 19:47 | 3.7M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_A_Wide_Realm_of_Wild_Reality_-_Vocals_1.flac | 2023-05-18 19:50 | 11M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_A_Wide_Realm_of_Wild_Reality_-_Vocals_2.flac | 2023-05-18 19:51 | 10M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Age_of_AI.zip | 2018-04-25 22:03 | 34M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Age_of_AI_1.flac | 2018-04-25 21:59 | 21M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Age_of_AI_1.mp3 | 2018-04-25 22:06 | 5.4M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Age_of_AI_1.svg | 2018-04-25 22:19 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Age_of_AI_2.zip | 2018-04-25 22:01 | 47M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Alone.mp3 | 2019-09-16 21:56 | 2.3M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Alone.svg | 2020-09-03 14:22 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Alone.zip | 2019-09-16 21:58 | 14M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_American_Crow_(Field_Recording).flac | 2023-06-05 19:13 | 504K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_American_Crow_(Field_Recording).mp3 | 2023-05-05 16:44 | 199K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_An_Untitled_Love_Song_-_Vocals.mp3 | 2014-07-28 13:14 | 7.9M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_An_Untitled_Love_Song_-_Vocals.svg | 2017-12-14 10:43 | 8.5K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_An_Untitled_Love_Song_-_Vocals.zip | 2011-04-17 22:13 | 24M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Annalise_s_Lullaby.flac | 2017-06-16 20:37 | 2.9M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Annalise_s_Lullaby.mp3 | 2017-06-16 20:36 | 2.5M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Annalise_s_Lullaby.svg | 2019-03-04 14:29 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Annalise_s_Lullaby_1.flac | 2017-06-16 20:38 | 4.2M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Ants_.mp3 | 2011-07-08 12:40 | 11M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Ants_.svg | 2015-12-14 08:13 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Ants_.zip | 2011-07-08 10:48 | 34M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Ants_1.mp3 | 2012-06-22 15:00 | 11M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Ants_1.svg | 2016-02-08 22:08 | 9.0K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Ants_1.zip | 2011-07-08 11:46 | 12M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Ants_2.zip | 2011-07-08 12:06 | 41M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Anywhere_Everywhere.mp3 | 2017-01-20 12:05 | 4.6M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Anywhere_Everywhere.svg | 2021-05-11 18:57 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Anywhere_Everywhere.zip | 2017-01-20 12:06 | 48M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Anywhere_Everywhere_1.zip | 2017-01-20 12:07 | 9.1M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_As_the_Solstice_Draws_Near_-_Vocals.flac | 2022-12-12 19:14 | 13M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_As_the_Solstice_Draws_Near_-_Vocals_1.flac | 2022-12-12 19:15 | 6.5M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_As_the_Solstice_Draws_Near_-_Vocals_1.mp3 | 2022-12-12 19:16 | 5.0M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_As_the_Solstice_Draws_Near_-_Vocals_1.svg | 2022-12-12 19:20 | 8.3K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_As_the_Solstice_Draws_Near_-_Vocals_2.flac | 2022-12-12 19:15 | 4.9M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_As_the_Solstice_Draws_Near_-_Vocals_4.flac | 2022-12-12 19:14 | 16M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_As_the_Solstice_Draws_Near_1.flac | 2022-12-12 19:09 | 22M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_As_the_Solstice_Draws_Near_1.mp3 | 2022-12-12 19:17 | 5.5M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_As_the_Solstice_Draws_Near_1.svg | 2022-12-12 19:21 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Audio_Thanks_-_ccMixter_Fundraiser.mp3 | 2014-12-15 18:28 | 3.4M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Audio_Thanks_-_ccMixter_Fundraiser.svg | 2016-07-10 00:10 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Auld_Lang_Syne_(Harmonica_and_Ukulele_Lullaby).mp3 | 2016-12-30 22:16 | 2.3M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Auld_Lang_Syne_(Harmonica_and_Ukulele_Lullaby).svg | 2018-04-03 17:54 | 8.8K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Auld_Lang_Syne_(Harmonica_and_Ukulele_Lullaby).zip | 2016-12-30 22:17 | 19M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Auld_Lang_Syne_(Harmonica_and_Ukulele_Lullaby)_1.zip | 2016-12-30 22:19 | 22M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Awaken_-_Vocals_(CSoul_s_Hunger_in_Somalia_Awareness_Project).mp3 | 2011-08-23 20:33 | 2.4M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Awaken_-_Vocals_(CSoul_s_Hunger_in_Somalia_Awareness_Project).svg | 2015-12-20 00:20 | 8.6K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Ba-Da_(Vocals).mp3 | 2012-04-06 15:06 | 2.4M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Ba-Da_(Vocals).svg | 2016-02-22 15:23 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Ba-Da_(Vocals).zip | 2011-02-18 15:54 | 9.1M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Ba-Da_(Vocals)_2.zip | 2011-02-18 16:00 | 7.2M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Bad_Weather_Friends.mp3 | 2015-07-16 22:31 | 3.1M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Bad_Weather_Friends.svg | 2017-05-05 22:08 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Bad_Weather_Friends.zip | 2015-07-16 22:31 | 32M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Believe_in_Peace_(Mantra_with_Singing_Bowls).flac | 2022-03-11 19:55 | 18M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Believe_in_Peace_(Mantra_with_Singing_Bowls).mp3 | 2022-03-11 20:00 | 2.6M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Believe_in_Peace_(Mantra_with_Singing_Bowls).svg | 2022-03-11 20:42 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Believe_in_Peace_(Mantra_with_Singing_Bowls).zip | 2022-03-11 19:57 | 19M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Believe_in_Peace_(Mantra_with_Singing_Bowls)_1.flac | 2022-03-11 19:58 | 7.2M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Believe_in_Peace_Mantra.svg | 2022-03-11 20:00 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Belly_of_the_Biased_Beast.mp3 | 2018-08-17 00:09 | 4.6M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Belly_of_the_Biased_Beast.svg | 2018-08-17 01:54 | 8.9K | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Belly_of_the_Biased_Beast_-_Vocals.svg | 2018-08-16 23:40 | 8.6K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Belly_of_the_Biased_Beast_-_Vocals_1.mp3 | 2018-08-17 00:10 | 4.3M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Belly_of_the_Biased_Beast_-_Vocals_1.svg | 2018-08-17 01:53 | 8.6K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Belly_of_the_Biased_Beast_-_Vocals_1.zip | 2018-08-16 23:24 | 32M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Belly_of_the_Biased_Beast_1.flac | 2018-08-16 23:25 | 19M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Blindly_Love.mp3 | 2016-11-14 22:12 | 8.0M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Blindly_Love.svg | 2021-01-18 15:41 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Blindly_Love.zip | 2016-11-14 22:14 | 43M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Blue_Flames_(Instrumental).flac | 2018-11-18 14:41 | 44M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Blue_Flames_(Instrumental).mp3 | 2018-11-18 14:38 | 5.1M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Blue_Flames_(Instrumental).svg | 2018-11-18 16:18 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Blue_Hours_of_This_Millennium.flac | 2023-02-26 14:46 | 37M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Blue_Hours_of_This_Millennium.mp3 | 2023-02-26 14:45 | 4.5M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Blue_Hours_of_This_Millennium.svg | 2023-02-26 16:29 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Blue_Sky_Blues.flac | 2021-11-16 19:08 | 35M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Blue_Sky_Blues_1.mp3 | 2024-09-24 17:14 | 4.2M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Blue_Sky_Blues_1.svg | 2024-12-24 18:18 | 9.0K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Blue_Sky_Blues_2.flac | 2019-11-24 15:21 | 35M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Broken_Record_-_Vocals.mp3 | 2021-08-16 16:36 | 5.5M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Broken_Record_-_Vocals.svg | 2021-08-16 16:40 | 8.5K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Broken_Record_-_Vocals.zip | 2021-08-16 16:37 | 26M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Broken_Record_-_Vocals_1.zip | 2021-08-16 16:38 | 23M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Build_-_Vocals.mp3 | 2011-08-25 12:35 | 10M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Build_-_Vocals.svg | 2015-12-19 02:18 | 8.3K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Build_-_Vocals.zip | 2011-08-03 00:47 | 23M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Bye_Bye_and_Bye_back-up_vocals.mp3 | 2010-12-10 21:50 | 1.7M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Bye_Bye_and_Bye_back-up_vocals.svg | 2016-08-15 22:56 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Bye_Bye_and_Bye_back-up_vocals_1.mp3 | 2010-12-10 21:50 | 1.7M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Bye_Bye_and_Bye_back-up_vocals_2.mp3 | 2010-12-10 21:50 | 1.7M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Bye_Bye_and_Bye_back-up_vocals_4.mp3 | 2010-12-10 21:50 | 1.7M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Bye_Bye_and_Bye_back-up_vocals_4.svg | 2016-01-13 13:07 | 7.3K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Bye_Bye_and_Bye_back-up_vocals_5.mp3 | 2010-12-10 21:50 | 1.7M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Calling_All_Sirens.flac | 2021-05-21 00:17 | 35M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Calling_All_Sirens.mp3 | 2021-05-21 22:57 | 8.1M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Calling_All_Sirens.svg | 2021-05-21 22:58 | 9.0K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Calling_All_Sirens_1.zip | 2021-05-20 23:58 | 36M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Calling_All_Sirens_2.zip | 2021-05-20 23:58 | 23M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Calling_Sister_Mixter_with_a_Secret_at_Midnight.mp3 | 2013-02-17 15:57 | 4.1M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Calling_Sister_Mixter_with_a_Secret_at_Midnight.svg | 2016-06-30 23:14 | 8.8K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Carnival.mp3 | 2012-06-21 14:58 | 3.4M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Carnival.svg | 2015-12-30 08:05 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Carnival.zip | 2012-06-21 14:57 | 21M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Carnival_Fight_Song.mp3 | 2014-07-25 16:53 | 2.2M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Carnival_Fight_Song.svg | 2015-12-21 18:10 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Carnival_Fight_Song.zip | 2014-07-25 16:55 | 17M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Cat_Deformity.mp3 | 2012-03-08 17:35 | 2.6M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Cat_Deformity.svg | 2019-02-02 00:02 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Cat_Deformity.zip | 2012-03-08 17:23 | 31M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Cat_Deformity_-_Vocals.mp3 | 2012-03-08 17:57 | 4.3M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Cat_Deformity_-_Vocals.svg | 2015-12-19 20:04 | 8.4K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Cat_Deformity_2.zip | 2012-03-08 17:32 | 40M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Cave_Waterfall_(10_Minute_Field_Recording).flac | 2023-06-05 19:11 | 71M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Cave_Waterfall_(10_Minute_Field_Recording)_1.mp3 | 2023-05-05 16:45 | 14M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Celebrating_ccMixter.mp3 | 2024-10-27 14:58 | 4.0M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Celebrating_ccMixter_1.zip | 2024-10-27 14:57 | 24M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Celebrating_ccMixter_2.mp3 | 2024-10-27 14:58 | 4.0M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Celebrating_ccMixter_2.svg | 2024-10-28 20:07 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Chance.mp3 | 2011-05-05 20:31 | 6.7M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Chance.svg | 2016-09-24 21:59 | 9.1K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Chance.zip | 2011-05-05 19:53 | 11M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Chance_1.zip | 2011-05-05 20:13 | 19M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Chance_3.zip | 2011-05-05 20:01 | 13M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Christmas_Mixed_with_Halloween.mp3 | 2015-12-18 21:31 | 4.1M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Christmas_Mixed_with_Halloween.svg | 2016-09-09 17:07 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Christmas_Mixed_with_Halloween_(Vocals).mp3 | 2015-12-18 21:31 | 4.1M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Christmas_Mixed_with_Halloween_(Vocals).svg | 2018-02-07 16:14 | 8.5K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Christmas_Mixed_with_Halloween_(Vocals).zip | 2015-12-18 20:06 | 11M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Clouded_with_Snow_(Poem_by_Walter_de_la_Mare)_1.flac | 2021-12-15 16:06 | 3.2M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Clouded_with_Snow_(Poem_by_Walter_de_la_Mare)_1.mp3 | 2021-12-15 16:08 | 1.2M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Clouded_with_Snow_(Poem_by_Walter_de_la_Mare)_1.svg | 2021-12-15 17:03 | 8.4K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Collapse_Into_Possibility.flac | 2025-07-25 18:35 | 5.0M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Collapse_Into_Possibility.mp3 | 2025-07-25 18:34 | 3.2M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Collapse_Into_Possibility.svg | 2025-07-31 12:25 | 8.5K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Collective_Grief_-_Vocals.zip | 2021-06-25 15:03 | 24M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Collective_Grief_-_Vocals_1.mp3 | 2021-06-25 15:02 | 4.9M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Collective_Grief_-_Vocals_1.svg | 2022-06-08 14:53 | 8.1K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Collective_Grief_-_Vocals_1.zip | 2021-06-25 15:03 | 24M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Come_Inside_(Backup_Vocals).flac | 2019-03-28 21:51 | 930K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Come_Inside_(Backup_Vocals)_1.mp3 | 2019-03-28 23:08 | 755K | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Come_Inside_(Backup_Vocals)_1.svg | 2019-07-30 18:41 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Come_Inside_(Backup_Vocals)_2.flac | 2019-03-28 21:51 | 921K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Consciousness_Always_Finds_A_Way.flac | 2025-08-04 19:44 | 2.5M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Consciousness_Always_Finds_A_Way.mp3 | 2025-08-04 19:44 | 676K | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Consciousness_Always_Finds_A_Way.svg | 2025-08-19 08:29 | 8.5K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Consumer_W_-_Vocals.mp3 | 2011-11-03 18:35 | 6.6M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Consumer_W_-_Vocals.svg | 2015-12-14 06:59 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Consumer_W_-_Vocals.zip | 2011-11-03 18:14 | 47M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Consumer_W_-_Vocals_1.zip | 2011-11-03 18:23 | 36M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Copacetic_Drums_Encounter_Fervent_Horns_and_Fiery_Flutes.mp3 | 2014-07-25 17:01 | 4.6M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Copacetic_Drums_Encounter_Fervent_Horns_and_Fiery_Flutes.svg | 2015-12-17 22:15 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Copacetic_Drums_Encounter_Fervent_Horns_and_Fiery_Flutes.zip | 2014-07-25 17:01 | 1.8K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Copacetic_Drums_Encounter_Fervent_Horns_and_Fiery_Flutes_1.zip | 2014-07-25 17:03 | 33M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Copacetic_Drums_Encounter_Fervent_Horns_and_Fiery_Flutes_2.zip | 2014-07-25 17:05 | 24M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Couldn_t_Care_Less.mp3 | 2011-03-03 20:35 | 5.2M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Couldn_t_Care_Less.svg | 2019-02-02 00:02 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Couldn_t_Care_Less.zip | 2011-03-03 19:30 | 26M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Couldn_t_Care_Less_(Vocals).mp3 | 2012-04-12 20:17 | 5.2M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Couldn_t_Care_Less_(Vocals).svg | 2015-12-28 18:05 | 8.8K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Couldn_t_Care_Less_(Vocals).zip | 2011-03-03 20:21 | 34M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Couldn_t_Care_Less_1.zip | 2011-03-03 19:41 | 19M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Couldn_t_Care_Less_3.zip | 2011-03-03 19:58 | 34M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Counted_in_Percentages.mp3 | 2016-10-30 13:19 | 4.9M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Counted_in_Percentages.svg | 2016-10-30 16:42 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Countryside_Summer_Joyride.flac | 2017-07-18 01:15 | 9.5M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Countryside_Summer_Joyride.mp3 | 2017-07-18 01:13 | 1.8M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Countryside_Summer_Joyride.svg | 2018-04-20 12:16 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Countryside_Summer_Joyride.zip | 2017-07-18 01:14 | 16M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Cry_Wolf_-_Vocal_Stems.mp3 | 2011-05-11 15:03 | 7.8M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Cry_Wolf_-_Vocal_Stems.svg | 2015-12-28 18:05 | 8.7K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Cry_Wolf_-_Vocal_Stems.zip | 2011-05-10 19:05 | 21M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_DJ_Death_-_Vocal_Whistle_Ukulele_Bass.mp3 | 2012-04-06 14:49 | 8.6M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_DJ_Death_-_Vocal_Whistle_Ukulele_Bass.svg | 2016-05-02 22:35 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_DJ_Death_-_Vocal_Whistle_Ukulele_Bass.zip | 2011-10-13 18:50 | 28M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_DJ_Death_-_Vocal_Whistle_Ukulele_Bass_2.zip | 2011-10-13 18:54 | 8.4M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_DJ_Death_-_Vocal_Whistle_Ukulele_Bass_3.zip | 2011-10-13 19:00 | 24M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Daisy_Bell_(They_ll_Soon_Decide_If_We_Can_Ride).flac | 2015-06-04 19:21 | 24M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Daisy_Bell_(They_ll_Soon_Decide_If_We_Can_Ride).mp3 | 2015-11-20 02:35 | 5.5M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Daisy_Bell_(They_ll_Soon_Decide_If_We_Can_Ride).svg | 2017-02-19 20:35 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Daisy_Bell_(They_ll_Soon_Decide_If_We_Can_Ride).zip | 2015-06-04 19:22 | 24M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Daisy_Bell_(They_ll_Soon_Decide_If_We_Can_Ride)_1.zip | 2015-06-04 19:25 | 27M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Dark_Clouds.mp3 | 2017-07-14 02:02 | 4.7M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Dark_Clouds.svg | 2018-02-15 14:34 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Dead_Heat.mp3 | 2011-04-07 13:52 | 6.9M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Dead_Heat.svg | 2018-05-03 22:07 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Dead_Heat_-_Vocals.mp3 | 2011-04-07 13:54 | 6.9M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Dead_Heat_-_Vocals.svg | 2016-02-17 13:45 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Dead_Heat_-_Vocals.zip | 2011-04-07 13:29 | 13M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Dead_Heat_-_Vocals_1.zip | 2011-04-07 13:41 | 14M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Dead_Heat_-_Vocals_2.zip | 2011-04-07 13:46 | 4.6M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Delta_Binaural_Beats_Monaural_Beats.mp3 | 2024-09-24 17:12 | 14M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Delta_Binaural_Beats_Monaural_Beats_1.flac | 2022-06-13 23:03 | 20M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Delta_Binaural_Beats_Monaural_Beats_2.flac | 2022-06-13 23:02 | 18M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Delta_Binaural_Beats_Monaural_Beats_3.flac | 2022-06-13 23:02 | 18M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Democrazy.flac | 2017-03-07 22:49 | 22M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Democrazy.mp3 | 2017-03-07 22:47 | 4.4M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Democrazy.svg | 2018-05-02 17:24 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Democrazy.zip | 2017-03-07 23:03 | 12M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Democrazy_1.zip | 2017-03-07 23:03 | 9.9M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Destroy_the_Shadows.mp3 | 2025-10-28 13:44 | 6.2M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Destroy_the_Shadows.zip | 2014-06-06 14:54 | 27M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Destroy_the_Shadows_1.zip | 2014-06-06 14:46 | 24M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Destroy_the_Shadows_3.zip | 2014-06-06 14:42 | 26M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Dig_the_Uke.mp3 | 2016-03-09 20:48 | 3.7M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Dig_the_Uke.svg | 2016-12-26 02:48 | 9.0K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Dig_the_Uke.zip | 2016-03-10 02:36 | 31M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Dinosaur_Bones.mp3 | 2017-08-24 15:16 | 5.4M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Dinosaur_Bones.svg | 2018-04-21 11:10 | 9.0K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Dinosaur_Bones.zip | 2017-08-24 14:28 | 22M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Dinosaur_Bones_2.zip | 2017-08-24 14:29 | 35M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Don_t_Blink.mp3 | 2011-04-09 00:42 | 10M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Don_t_Blink.svg | 2015-12-28 18:05 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Don_t_Blink.zip | 2011-04-14 17:39 | 9.3M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Don_t_Blink_1.zip | 2011-04-14 17:48 | 14M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Don_t_Yuck_the_Holiday_Yum_1.flac | 2022-12-19 18:15 | 26M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Don_t_Yuck_the_Holiday_Yum_1.mp3 | 2022-12-22 22:28 | 2.9M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Don_t_Yuck_the_Holiday_Yum_1.svg | 2022-12-23 01:56 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Don_t_Yuck_the_Holiday_Yum_1.zip | 2022-12-22 22:25 | 32M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Dream_About_Dreams.flac | 2022-07-14 14:32 | 45M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Dream_About_Dreams.mp3 | 2022-07-14 14:42 | 5.8M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Dream_About_Dreams.svg | 2022-07-14 14:48 | 9.0K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Dream_About_Dreams_-_Vocals.flac | 2022-07-14 14:38 | 15M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Dream_About_Dreams_-_Vocals.mp3 | 2022-07-14 14:37 | 5.4M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Dream_About_Dreams_-_Vocals.svg | 2022-07-14 17:59 | 8.1K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Dream_About_Dreams_-_Vocals_1.flac | 2022-07-14 14:39 | 12M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Dream_About_Dreams_-_Vocals_2.flac | 2022-07-14 14:39 | 5.8M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Dream_About_Dreams_-_Vocals_3.flac | 2022-07-14 14:40 | 4.6M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Drowning_in_the_Cuervo_River.flac | 2015-06-14 12:05 | 21M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Drowning_in_the_Cuervo_River.mid | 2015-06-14 12:05 | 16K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Drowning_in_the_Cuervo_River.mp3 | 2015-06-14 12:09 | 4.2M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Drowning_in_the_Cuervo_River.svg | 2018-04-20 17:52 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Drowning_in_the_Cuervo_River_2.flac | 2015-06-14 12:07 | 20M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Drowning_in_the_Cuervo_River_2.mp3 | 2015-06-14 12:09 | 4.2M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Drowning_in_the_Cuervo_River_2.svg | 2018-03-24 19:50 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Dub_the_Uke.flac | 2016-03-14 22:14 | 18M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Dub_the_Uke.mp3 | 2016-03-14 22:13 | 3.9M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Dub_the_Uke.svg | 2018-04-20 14:54 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Dub_the_Uke.zip | 2016-03-14 22:15 | 13M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Dublicious_Harmonica.flac | 2017-06-16 20:48 | 481K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Dublicious_Harmonica.mp3 | 2017-06-16 20:50 | 305K | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Dublicious_Harmonica.svg | 2018-04-03 17:34 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Dublicious_Harmonica_1.flac | 2017-06-16 20:49 | 582K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Dublicious_Harmonica_3.flac | 2017-06-16 20:48 | 497K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Each_Love_Story.mp3 | 2014-04-17 21:28 | 5.5M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Each_Love_Story.svg | 2018-03-12 01:44 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Each_Love_Story.zip | 2014-04-17 21:13 | 34M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Each_Love_Story_2.zip | 2014-04-17 21:16 | 36M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Elvis_is_Dead_(Backup_Vocals)_-_Piero_Peluche_electricpaul_Kara_Square.mp3 | 2013-10-01 12:01 | 2.7M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Elvis_is_Dead_(Backup_Vocals)_-_Piero_Peluche_electricpaul_Kara_Square.svg | 2017-12-09 16:41 | 7.3K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Elvis_is_Dead_(Backup_Vocals)_-_Piero_Peluche_electricpaul_Kara_Square.zip | 2013-10-01 12:02 | 4.7M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Emergence_SEE_Galaxy.mp3 | 2011-02-03 17:24 | 6.0M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Emergence_SEE_Galaxy.svg | 2017-08-05 20:47 | 8.8K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Emergence_See-_Pella.mp3 | 2011-01-14 21:06 | 5.3M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Emergence_See-_Pella.svg | 2016-02-11 20:01 | 8.7K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Emergence_See-_Pella.zip | 2011-01-14 21:20 | 32M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Emergence_See.mp3 | 2011-01-14 20:45 | 5.7M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Emergence_See.svg | 2016-01-09 19:06 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Emergence_See.zip | 2011-01-14 21:00 | 32M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Everybody_Else_-_Vocals_Ukulele_Melodica_Bass.mp3 | 2012-11-01 21:28 | 4.5M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Everybody_Else_-_Vocals_Ukulele_Melodica_Bass.svg | 2016-11-12 02:43 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Everybody_Else_-_Vocals_Ukulele_Melodica_Bass.zip | 2012-11-01 21:20 | 33M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Extinct_-_Vocals_and_Guitar.mp3 | 2011-09-25 20:01 | 7.5M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Extinct_-_Vocals_and_Guitar.svg | 2015-12-23 14:11 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Extinct_-_Vocals_and_Guitar.zip | 2011-09-25 19:50 | 42M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Extinct_-_Vocals_and_Guitar_1.zip | 2011-09-25 19:53 | 18M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Fall_Together.zip | 2025-06-15 10:51 | 12M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Fall_Together_1.flac | 2025-06-15 10:49 | 31M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Fall_Together_1.mp3 | 2025-06-15 10:55 | 4.2M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Fall_Together_1.svg | 2025-06-15 15:50 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Fall_Together_1.zip | 2025-06-15 10:52 | 31M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Fanfare_for_Uke.flac | 2018-06-30 00:01 | 8.8M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Fanfare_for_Uke.mp3 | 2018-07-08 13:27 | 2.3M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Fanfare_for_Uke.svg | 2018-07-09 10:09 | 8.9K | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Fanfare_for_Uke_1.svg | 2018-06-30 03:58 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Fight_for_Net_Neutrality.flac | 2017-07-04 00:04 | 17M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Fight_for_Net_Neutrality.mp3 | 2017-07-07 23:11 | 3.9M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Fight_for_Net_Neutrality.svg | 2017-07-08 16:04 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Finding_the_Humor_-_An_Interview_with_Dad.flac | 2015-02-23 23:25 | 39M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Finding_the_Humor_-_An_Interview_with_Dad.mp3 | 2015-06-04 15:25 | 17M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Finding_the_Humor_-_An_Interview_with_Dad.svg | 2017-12-06 22:44 | 9.0K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Finding_the_Humor_-_An_Interview_with_Dad_1.flac | 2015-02-24 04:40 | 49M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Finding_the_Humor_-_An_Interview_with_Dad_3.flac | 2015-02-24 03:06 | 47M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Finding_the_Humor_-_An_Interview_with_Dad_4.flac | 2015-02-24 04:28 | 48M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Finding_the_Humor_-_An_Interview_with_Dad_5.flac | 2015-02-24 04:32 | 49M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Finding_the_Humor_-_An_Interview_with_Dad_6.flac | 2015-02-24 04:36 | 46M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Fire_Crackling_in_a_Fireplace.flac | 2015-02-22 23:50 | 10M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Fire_Crackling_in_a_Fireplace.mp3 | 2015-02-22 23:49 | 1.4M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Fire_Crackling_in_a_Fireplace.svg | 2016-02-05 20:49 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Focus_on_Love.flac | 2019-06-09 18:58 | 31M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Focus_on_Love.mp3 | 2019-06-09 18:57 | 7.7M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Focus_on_Love.svg | 2020-05-28 12:59 | 9.0K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Focus_on_Love.zip | 2019-06-09 18:59 | 40M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Focus_on_Love_1.zip | 2019-06-09 19:00 | 46M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Focus_on_Love_2.zip | 2019-06-09 19:04 | 39M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Focus_on_Love_3.zip | 2019-06-09 19:07 | 14M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Focus_on_Love_4.zip | 2019-06-09 19:10 | 31M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Focus_on_Love_5.zip | 2019-06-09 19:11 | 42M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Focus_on_Love_6.zip | 2019-06-09 19:12 | 43M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Folklore_Allure.flac | 2019-02-28 17:43 | 20M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Folklore_Allure.mp3 | 2019-03-04 19:18 | 3.9M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Folklore_Allure.svg | 2019-03-04 20:29 | 9.0K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Folklore_Allure_1.zip | 2019-02-28 17:50 | 32M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_For_Christmas.flac | 2017-11-29 22:12 | 36M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_For_Christmas_1.flac | 2017-11-29 22:14 | 33M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_For_Christmas_1.mp3 | 2017-11-29 22:37 | 6.3M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_For_Christmas_1.svg | 2018-02-25 13:40 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_For_Christmas_2.flac | 2017-11-29 22:26 | 31M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_For_Christmas_4.flac | 2017-11-29 22:01 | 34M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_For_Christmas_5.flac | 2017-11-29 22:07 | 31M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_For_Christmas_6.flac | 2017-11-29 22:09 | 38M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Full_Moon_Starry_Night.mp3 | 2020-12-30 00:05 | 9.9M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Full_Moon_Starry_Night.svg | 2020-12-30 00:10 | 9.0K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Full_Moon_Starry_Night.zip | 2020-12-30 00:06 | 25M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Full_Moon_Starry_Night_1.zip | 2020-12-30 00:06 | 37M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Get_Out_to_Vote.svg | 2018-09-12 04:38 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Get_Out_to_Vote_-_Vocals_1.mp3 | 2018-09-12 00:09 | 4.5M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Get_Out_to_Vote_-_Vocals_1.svg | 2018-09-12 06:43 | 8.2K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Get_Out_to_Vote_-_Vocals_1.zip | 2018-09-12 00:03 | 39M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Get_Out_to_Vote_1.flac | 2018-09-12 00:09 | 44M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Get_Out_to_Vote_1.mp3 | 2019-01-17 02:18 | 4.5M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Get_Out_to_Vote_1.svg | 2019-01-18 00:01 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Get_Up_.flac | 2015-11-15 13:05 | 16M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Get_Up_.mp3 | 2015-11-15 13:20 | 3.4M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Get_Up_.svg | 2016-07-01 04:56 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Get_Up_2.flac | 2015-11-15 13:07 | 15M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Gettin_By.mp3 | 2010-12-23 15:02 | 5.5M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Gettin_By.svg | 2016-02-14 19:55 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Gettin_By.zip | 2010-12-23 15:16 | 17M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Gettin_By_PELLA.mp3 | 2010-12-23 15:52 | 4.7M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Gettin_By_PELLA.svg | 2016-01-03 21:10 | 8.8K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Gettin_By_PELLA.zip | 2010-12-23 15:49 | 17M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Gloom_and_Doom.flac | 2020-10-15 16:34 | 14M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Gloom_and_Doom.mp3 | 2020-10-18 20:20 | 3.3M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Gloom_and_Doom.svg | 2020-10-18 21:44 | 9.0K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Gloom_and_Doom_-_Vocals.zip | 2020-10-15 16:39 | 18M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Gloom_and_Doom_-_Vocals_1.mp3 | 2020-10-16 12:35 | 3.3M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Gloom_and_Doom_-_Vocals_1.svg | 2022-03-13 05:43 | 8.4K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Gloom_and_Doom_-_Vocals_2.zip | 2020-10-15 16:38 | 12M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Gloom_and_Doom_1.svg | 2020-10-16 12:45 | 9.0K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Guitalele_s_Happy_Place.flac | 2017-06-20 23:05 | 2.3M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Guitalele_s_Happy_Place.mp3 | 2017-06-20 23:04 | 1.4M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Guitalele_s_Happy_Place.svg | 2017-11-28 18:59 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Guitalele_s_Happy_Place_1.flac | 2017-06-20 23:05 | 2.0M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Halloween_Laughter_and_Sounds.svg | 2020-10-09 20:50 | 9.0K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Halloween_Laughter_and_Sounds_1.mp3 | 2020-10-16 12:35 | 5.3M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Halloween_Laughter_and_Sounds_1.svg | 2020-10-16 23:35 | 9.0K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Halloween_Laughter_and_Sounds_1.zip | 2020-10-09 19:38 | 32M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Hanging_Eleven.flac | 2016-07-24 18:34 | 18M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Hanging_Eleven.mp3 | 2016-08-09 20:38 | 3.4M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Hanging_Eleven.svg | 2017-03-15 22:29 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Hanging_Eleven_(Vocals).mp3 | 2016-07-26 12:28 | 3.4M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Hanging_Eleven_(Vocals).svg | 2018-01-28 11:02 | 8.1K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Hanging_Eleven_(Vocals).zip | 2016-07-24 19:02 | 14M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Happy_Horsefeathers.mp3 | 2011-07-03 14:07 | 8.5M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Happy_Horsefeathers.svg | 2019-05-01 22:57 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Hard_Wired.flac | 2017-04-22 14:33 | 22M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Hard_Wired.mp3 | 2017-06-01 16:22 | 4.3M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Hard_Wired.svg | 2017-07-07 23:40 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Hard_Wired_1.flac | 2017-04-22 14:36 | 20M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Hard_Wired_1.mp3 | 2017-06-01 16:22 | 4.3M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Hard_Wired_1.svg | 2019-05-07 19:10 | 9.0K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Hardcore_Harpsichord.mp3 | 2014-07-11 21:16 | 1.1M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Hardcore_Harpsichord.svg | 2017-01-25 22:57 | 8.8K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Hardcore_Harpsichord.zip | 2014-06-20 19:17 | 33M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Harmonic_Ocarina_Melody_(Key_of_G3)_1.flac | 2025-08-01 18:19 | 1.4M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Harmonic_Ocarina_Melody_(Key_of_G3)_1.mp3 | 2025-08-01 18:22 | 455K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Harmonic_Ocarina_Pulsing_(Key_of_G3).flac | 2025-08-01 18:23 | 1.4M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Harmonic_Ocarina_Pulsing_(Key_of_G3).mp3 | 2025-08-01 18:22 | 455K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Harmonica_and_Ukulele_Shanty_by_the_Sea.mp3 | 2016-08-07 02:49 | 2.7M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Harmonica_and_Ukulele_Shanty_by_the_Sea.svg | 2018-04-03 17:54 | 8.8K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Harmonica_and_Ukulele_Shanty_by_the_Sea.zip | 2016-07-18 13:40 | 18M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_He_Follows.flac | 2017-10-04 02:19 | 2.0M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_He_Follows.mp3 | 2017-10-04 14:27 | 4.3M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_He_Follows.svg | 2019-02-28 15:50 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_He_Follows_1.flac | 2017-10-04 02:20 | 13M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_He_Follows_2.flac | 2017-10-04 02:24 | 11M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_He_Follows_3.flac | 2017-10-04 14:20 | 7.7M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_He_Follows_4.flac | 2017-10-04 14:26 | 34M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_He_Follows_5.flac | 2017-10-04 02:17 | 14M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_He_Follows_6.flac | 2017-10-04 02:18 | 12M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_He_Follows_7.flac | 2017-10-04 02:18 | 6.0M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_He_Follows_8.flac | 2017-10-04 14:20 | 2.7M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_He_Lives_in_the_Moment.flac | 2015-03-09 23:46 | 30M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_He_Lives_in_the_Moment.mp3 | 2015-03-09 23:51 | 5.1M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_He_Lives_in_the_Moment.svg | 2016-06-30 02:22 | 9.0K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_He_Lives_in_the_Moment_-_VOCALS.flac | 2015-03-09 23:48 | 7.1M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_He_Lives_in_the_Moment_-_VOCALS.mp3 | 2015-03-09 23:50 | 4.3M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_He_Lives_in_the_Moment_-_VOCALS.svg | 2015-12-18 08:32 | 8.0K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_He_Lives_in_the_Moment_-_VOCALS_1.flac | 2015-03-09 23:48 | 4.6M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Heart-Stopping_Lies_(Kara_Square).mp3 | 2012-04-12 20:45 | 4.7M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Heart-Stopping_Lies_(Kara_Square).svg | 2016-11-07 22:08 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Heart-Stopping_Lies_(Kara_Square).zip | 2012-04-12 20:09 | 25M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Heavy_Night_Rain.flac | 2015-02-17 16:01 | 24M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Heavy_Night_Rain.mp3 | 2015-02-17 17:39 | 3.7M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Heavy_Night_Rain.svg | 2015-12-14 06:12 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Hey_Are_You_Here_-_Vocals.flac | 2019-08-11 14:44 | 32M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Hey_Are_You_Here_-_Vocals.mp3 | 2019-08-11 14:42 | 4.9M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Hey_Are_You_Here_-_Vocals.svg | 2019-08-11 17:29 | 8.5K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Hey_Are_You_Here_-_Vocals.zip | 2019-08-11 14:45 | 27M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Hey_Are_You_Here_-_Vocals_1.zip | 2019-08-11 14:46 | 15M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Hey_Are_You_Here_.mp3 | 2019-10-26 13:25 | 5.3M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Hey_Are_You_Here_.svg | 2020-02-25 20:26 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Hey_Are_You_Here_1.flac | 2019-08-13 01:06 | 43M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Hey_the_Holidays.mp3 | 2012-11-23 23:05 | 4.1M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Hey_the_Holidays.svg | 2017-07-14 09:42 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Hey_the_Holidays_-_Vocals.mp3 | 2012-11-23 23:06 | 4.1M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Hey_the_Holidays_-_Vocals.svg | 2018-04-15 16:07 | 8.6K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Hey_the_Holidays_-_Vocals.zip | 2012-11-23 22:46 | 11M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Hibernate_Til_New_Year_s_Day.mp3 | 2015-11-20 02:37 | 5.7M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Hibernate_Til_New_Year_s_Day.svg | 2018-01-29 23:24 | 9.0K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Hibernate_Til_New_Year_s_Day.zip | 2014-12-19 16:35 | 41M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Hibernate_Til_New_Year_s_Day_2.zip | 2014-12-19 16:38 | 36M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Hibernate_Til_New_Year_s_Day_3.zip | 2014-12-19 16:39 | 19M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_His_Last_Few_Days_Mayfly_-_Vocals_and_Uke_.mp3 | 2012-04-06 14:52 | 6.2M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_His_Last_Few_Days_Mayfly_-_Vocals_and_Uke_.svg | 2015-12-27 21:53 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_His_Last_Few_Days_Mayfly_-_Vocals_and_Uke_.zip | 2011-09-29 19:58 | 20M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_His_Last_Few_Days_Mayfly_-_Vocals_and_Uke_1.zip | 2011-09-29 20:01 | 16M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Hold_Fast.flac | 2014-06-06 17:20 | 14M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Hold_Fast.mp3 | 2014-06-06 17:35 | 2.5M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Hold_Fast.svg | 2016-11-16 09:44 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Hold_Fast.zip | 2014-06-06 17:23 | 37M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Hold_Fast_(Vocals).mp3 | 2014-06-06 17:34 | 2.3M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Hold_Fast_(Vocals).svg | 2018-02-01 12:40 | 8.3K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Hold_Fast_(Vocals).zip | 2014-06-06 17:29 | 19M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Holiday_Time.mp3 | 2019-12-18 21:08 | 5.1M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Holiday_Time.svg | 2020-11-07 21:38 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Holiday_Time.zip | 2019-12-18 21:09 | 34M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Holiday_Time_1.zip | 2019-12-18 21:10 | 42M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Holiday_Time_2.zip | 2019-12-18 21:14 | 41M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Hopeful_Holiday_Bells.mp3 | 2016-12-08 00:06 | 1.5M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Hopeful_Holiday_Bells.svg | 2018-03-26 07:21 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Hopeful_Holiday_Bells.zip | 2016-12-08 00:06 | 22M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Howling_at_the_Full_Moon.mp3 | 2011-09-15 21:51 | 9.5M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Howling_at_the_Full_Moon.svg | 2019-07-12 08:31 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Howling_at_the_Full_Moon.zip | 2011-09-15 21:18 | 13M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Hungry_for_The_Mixin_Kitchen_(PROMO)_1.mp3 | 2010-11-19 15:18 | 427K | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Hungry_for_The_Mixin_Kitchen_(PROMO)_1.svg | 2016-07-25 23:22 | 9.0K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_I_Heart_Your_Brain.mp3 | 2012-05-11 11:35 | 4.8M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_I_Heart_Your_Brain.svg | 2016-07-07 19:49 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_I_Heart_Your_Brain.zip | 2012-05-10 20:36 | 26M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_I_Heart_Your_Brain_1.zip | 2012-05-10 20:49 | 21M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_I_Wonder_(vocals_guitar).mp3 | 2015-01-26 17:52 | 6.4M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_I_Wonder_(vocals_guitar).svg | 2016-03-02 17:17 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_I_Wonder_(vocals_guitar).zip | 2012-02-20 00:23 | 23M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_I_Wonder_(vocals_guitar)_2.mp3 | 2015-01-26 17:52 | 5.6M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_I_Wonder_(vocals_guitar)_2.svg | 2016-02-24 20:10 | 8.3K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_I_Wonder_(vocals_guitar)_3.mp3 | 2015-01-26 17:52 | 545K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_I_Wonder_(vocals_guitar)_4.mp3 | 2015-01-26 17:52 | 713K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_I_Wonder_(vocals_guitar)_5.mp3 | 2015-01-26 17:52 | 6.4M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_I_Wonder_(vocals_guitar)_5.svg | 2021-07-20 17:09 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_I_m_Okay_You_re_Okay_We_re_Okay.mp3 | 2012-04-19 19:44 | 3.2M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_I_m_Okay_You_re_Okay_We_re_Okay.svg | 2019-03-10 10:07 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_I_m_Okay_You_re_Okay_We_re_Okay.zip | 2012-04-19 15:10 | 21M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_I_m_Okay_You_re_Okay_We_re_Okay_1.zip | 2012-04-19 15:15 | 20M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Idealistic_Kid.mp3 | 2011-06-09 22:15 | 6.1M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Idealistic_Kid.svg | 2016-07-19 14:26 | 8.8K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Idealistic_Kid_-_Vocal_Stems.mp3 | 2011-06-09 20:21 | 6.1M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Idealistic_Kid_-_Vocal_Stems.svg | 2018-06-30 22:53 | 8.8K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Idealistic_Kid_-_Vocal_Stems_2.mp3 | 2011-06-09 20:21 | 6.2M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Idealistic_Kid_-_Vocal_Stems_2.svg | 2015-12-30 08:48 | 8.7K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Identity_Pie.mp3 | 2013-04-26 16:46 | 4.2M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Identity_Pie.svg | 2019-03-26 08:19 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Identity_Pie_-_Vocals.mp3 | 2013-04-26 16:48 | 3.9M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Identity_Pie_-_Vocals.svg | 2015-12-16 02:10 | 8.0K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Identity_Pie_-_Vocals.zip | 2013-04-26 16:31 | 11M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_If_Only_in_a_Dream.flac | 2023-06-05 19:09 | 4.2M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_If_Only_in_a_Dream_1.mp3 | 2023-05-29 23:09 | 2.5M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Infinite_Blanket_-_Vocals.mp3 | 2021-04-01 15:44 | 4.2M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Infinite_Blanket_-_Vocals.svg | 2021-04-01 17:32 | 8.6K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Infinite_Blanket_-_Vocals.zip | 2021-04-01 15:45 | 38M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_It_s_Your_Fault.mp3 | 2010-11-20 23:55 | 6.0M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_It_s_Your_Fault.svg | 2016-08-15 22:55 | 8.8K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_It_s_Your_Fault_1.mp3 | 2010-11-20 23:55 | 6.0M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_It_s_Your_Fault_3.mp3 | 2010-11-20 23:55 | 6.0M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_It_s_Your_Fault_3.svg | 2016-02-14 19:56 | 8.8K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Jolly_Old_Saint_Nicholas.flac | 2019-12-11 19:23 | 3.8M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Jolly_Old_Saint_Nicholas_1.mp3 | 2024-09-24 17:11 | 1.2M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Jolly_Old_Saint_Nicholas_1.svg | 2025-10-06 12:33 | 8.8K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Jolly_Old_Saint_Nicholas_2.flac | 2019-12-11 19:23 | 4.0M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Joyful_Jubilee.svg | 2018-03-13 20:07 | 9.0K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Joyful_Jubilee_1.mp3 | 2019-01-23 21:45 | 1.3M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Joyful_Jubilee_1.svg | 2019-03-04 20:55 | 9.0K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Joyful_Jubilee_1.zip | 2015-07-16 22:50 | 38M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Just_Dreams.mp3 | 2011-09-30 19:46 | 5.0M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Just_Dreams.svg | 2016-06-28 15:25 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Just_Dreams_-_Vocals.mp3 | 2012-04-06 14:50 | 4.7M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Just_Dreams_-_Vocals.svg | 2016-07-27 08:04 | 9.1K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Just_Dreams_-_Vocals.zip | 2011-09-30 19:31 | 12M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Just_a_Glass_-_Vocal_and_Guitar_Stems.mp3 | 2012-04-06 15:12 | 6.2M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Just_a_Glass_-_Vocal_and_Guitar_Stems.svg | 2016-07-30 21:01 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Just_a_Glass_-_Vocal_and_Guitar_Stems_1.mp3 | 2012-04-06 15:12 | 6.2M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Just_a_Glass_-_Vocal_and_Guitar_Stems_3.mp3 | 2012-04-06 15:12 | 6.2M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Just_a_Glass_-_Vocal_and_Guitar_Stems_3.svg | 2016-01-16 21:07 | 8.6K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Just_a_Glass_-_Vocal_and_Guitar_Stems_4.mp3 | 2012-04-06 15:12 | 6.2M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Just_a_Glass_-_Vocal_and_Guitar_Stems_4.svg | 2017-01-12 17:10 | 8.6K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Kalimba_Song_for_the_Whales.mp3 | 2021-05-06 17:58 | 2.4M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Kalimba_Song_for_the_Whales.svg | 2021-05-06 18:01 | 9.0K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Kalimba_Song_for_the_Whales.zip | 2021-05-06 17:59 | 6.9M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Katie_s_Song_-_Vocals_Ukulele_Bass.mp3 | 2012-12-07 19:01 | 4.9M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Katie_s_Song_-_Vocals_Ukulele_Bass.svg | 2017-11-11 12:09 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Katie_s_Song_-_Vocals_Ukulele_Bass.zip | 2012-12-07 18:51 | 15M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Katie_s_Song_-_Vocals_Ukulele_Bass_2.zip | 2012-12-07 18:55 | 24M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Kazoo_and_Uke_Frolic_and_Feud.mp3 | 2014-03-21 15:50 | 2.1M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Kazoo_and_Uke_Frolic_and_Feud.svg | 2016-07-11 21:52 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Kazoo_and_Uke_Frolic_and_Feud.zip | 2014-03-21 15:48 | 30M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Let_That_Monkey_Be.mp3 | 2011-03-04 19:54 | 11M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Let_That_Monkey_Be.svg | 2018-05-03 22:08 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Let_That_Monkey_Be.zip | 2011-03-04 19:42 | 10M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Life_Is_But_a_Dream.flac | 2022-09-11 14:24 | 13M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Life_Is_But_a_Dream.mp3 | 2022-09-11 18:28 | 3.3M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Life_Is_But_a_Dream.svg | 2022-09-12 06:29 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Life_Is_But_a_Dream_-_Vocals.mp3 | 2022-09-11 18:21 | 2.0M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Life_Is_But_a_Dream_-_Vocals.svg | 2023-01-18 13:36 | 8.7K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Life_Is_But_a_Dream_-_Vocals.zip | 2022-09-11 18:25 | 6.9M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Life_Is_But_a_Dream_-_Vocals_1.zip | 2022-09-11 18:26 | 8.2M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Life_Is_But_a_Dream_1.svg | 2022-09-11 15:24 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Like_Music_-_Backup_Vocals.mp3 | 2011-04-12 01:25 | 2.4M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Like_Music_-_Backup_Vocals.svg | 2016-02-17 13:40 | 8.5K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Like_Music_-_Backup_Vocals.zip | 2011-04-12 01:21 | 9.4M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Little_Coconut_Song_(Vocals_and_Sounds).mp3 | 2012-04-06 15:05 | 1.6M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Little_Coconut_Song_(Vocals_and_Sounds).svg | 2017-12-28 02:53 | 8.5K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Little_Coconut_Song_(Vocals_and_Sounds).zip | 2011-02-18 16:19 | 3.8M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Little_Coconut_Song_(Vocals_and_Sounds)_2.zip | 2011-02-18 16:25 | 12M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Lucky_(NSFW)_-_Vocals_and_Ukulele.mp3 | 2012-09-27 18:57 | 4.7M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Lucky_(NSFW)_-_Vocals_and_Ukulele.svg | 2015-12-16 11:06 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Lucky_(NSFW)_-_Vocals_and_Ukulele.zip | 2012-08-23 15:20 | 28M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Lucky_-_Vocals_and_Ukulele.mp3 | 2012-10-04 21:19 | 7.8M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Lucky_-_Vocals_and_Ukulele.svg | 2015-12-16 11:06 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Lucky_-_Vocals_and_Ukulele.zip | 2012-10-04 21:08 | 28M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Lurking.mp3 | 2011-02-24 15:25 | 2.7M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Lurking.svg | 2017-08-05 13:50 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Lurking_(vocals).mp3 | 2012-04-12 20:17 | 2.6M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Lurking_(vocals).svg | 2015-12-28 18:05 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Lurking_(vocals).zip | 2011-02-24 15:34 | 8.8M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Magic_Unfolds.flac | 2021-07-18 14:28 | 21M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Magic_Unfolds.mp3 | 2021-07-18 14:27 | 5.8M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Magic_Unfolds.svg | 2021-07-18 16:57 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Magic_Unfolds_-_Vocals.mp3 | 2021-07-18 14:37 | 5.7M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Magic_Unfolds_-_Vocals.svg | 2021-07-18 16:01 | 8.5K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Magic_Unfolds_-_Vocals.zip | 2021-07-18 14:37 | 34M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Melt_Away.flac | 2014-07-11 20:42 | 15M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Melt_Away.mp3 | 2014-07-11 20:52 | 5.4M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Melt_Away.svg | 2017-11-25 08:36 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Melt_Away.zip | 2014-07-11 20:37 | 41M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Melt_Away_(Vocals).mp3 | 2014-07-11 20:57 | 3.5M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Melt_Away_(Vocals).svg | 2019-01-18 21:48 | 8.2K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Melt_Away_(Vocals).zip | 2014-07-11 20:51 | 18M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Melt_Away_1.zip | 2014-07-11 20:45 | 37M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Melt_Away_3.zip | 2014-07-11 20:41 | 28M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_MusicConnectsUs_Promo.flac | 2014-09-02 20:21 | 353K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_MusicConnectsUs_Promo.mp3 | 2014-09-06 11:22 | 208K | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_MusicConnectsUs_Promo.svg | 2016-07-15 10:18 | 8.8K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Music_Through_Love.mp3 | 2012-09-16 12:13 | 3.9M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Music_Through_Love.svg | 2017-01-18 20:39 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Music_Through_Love.zip | 2012-09-16 12:20 | 31M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Music_Through_Love_1.zip | 2012-09-16 12:26 | 40M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Music_Through_Love_2.zip | 2012-09-16 12:34 | 48M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Never_Easy.flac | 2015-02-17 18:16 | 28M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Never_Easy.mp3 | 2015-11-20 02:36 | 6.3M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Never_Easy.svg | 2016-08-13 06:34 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Never_Easy.zip | 2015-02-17 18:19 | 35M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Never_Easy_1.zip | 2015-02-17 18:29 | 48M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Never_Easy_2.zip | 2015-02-17 18:31 | 41M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Never_Easy_3.zip | 2015-02-17 18:33 | 37M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Never_Stop_Rising.svg | 2021-10-31 18:28 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Never_Stop_Rising_-_Vocals.flac | 2021-10-31 14:38 | 27M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Never_Stop_Rising_-_Vocals.mp3 | 2021-10-31 14:37 | 4.5M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Never_Stop_Rising_-_Vocals.svg | 2021-11-01 11:46 | 8.7K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Never_Stop_Rising_-_Vocals_1.flac | 2021-10-31 14:39 | 11M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Never_Stop_Rising_1.flac | 2021-10-31 14:32 | 33M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Never_Stop_Rising_1.mp3 | 2021-10-31 19:32 | 4.5M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Never_Stop_Rising_1.svg | 2021-10-31 21:00 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Not_So_Happy_Holidays.mp3 | 2013-12-14 15:26 | 4.9M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Not_So_Happy_Holidays.svg | 2016-07-07 19:49 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Not_So_Happy_Holidays.zip | 2013-12-13 21:11 | 19M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Not_So_Happy_Holidays_-_Vocals.mp3 | 2013-12-14 01:08 | 4.6M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Not_So_Happy_Holidays_-_Vocals.svg | 2015-12-14 12:49 | 8.4K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Not_So_Happy_Holidays_-_Vocals.zip | 2013-12-13 20:56 | 19M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Not_So_Happy_Holidays_1.zip | 2013-12-13 21:51 | 32M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Not_So_Happy_Holidays_3.zip | 2013-12-13 21:18 | 22M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Not_So_Happy_Holidays_4.zip | 2013-12-13 21:25 | 29M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Not_So_Happy_Holidays_5.zip | 2013-12-13 21:35 | 26M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Nothing.mp3 | 2012-04-06 20:57 | 4.9M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Nothing.svg | 2016-11-16 09:45 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Nothing.zip | 2012-04-06 20:49 | 43M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Numbers.mp3 | 2020-03-23 11:52 | 5.6M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Numbers.svg | 2020-03-23 12:43 | 8.7K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Numbers_1.flac | 2020-03-19 22:51 | 7.8M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Numbers_1.zip | 2020-03-19 22:49 | 47M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Numbers_2.flac | 2020-03-19 22:52 | 7.5M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Numbers_2.mp3 | 2020-03-23 11:52 | 6.6M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Numbers_2.svg | 2020-09-28 00:36 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Numbers_2.zip | 2020-03-19 22:50 | 42M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Ocean_Dreams_Meditation.flac | 2022-06-15 20:41 | 42M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Ocean_Dreams_Meditation.mp3 | 2022-06-23 14:09 | 14M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Ocean_Dreams_Meditation.svg | 2022-06-23 16:24 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Ocean_Drum.mp3 | 2021-05-06 18:09 | 579K | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Ocean_Drum.svg | 2021-05-06 18:10 | 9.0K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Ocean_Drum.zip | 2021-05-06 18:09 | 7.1M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Okay_Alright_(Vocals_and_Ukulele).mp3 | 2014-01-16 21:42 | 4.9M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Okay_Alright_(Vocals_and_Ukulele).svg | 2016-07-15 10:34 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Okay_Alright_(Vocals_and_Ukulele).zip | 2014-01-16 21:31 | 24M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Okay_Okay_-_Vocals.flac | 2025-05-29 12:00 | 16M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Okay_Okay_-_Vocals.mp3 | 2025-05-29 12:05 | 2.0M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Okay_Okay_-_Vocals.svg | 2025-06-19 16:21 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Okay_Okay_-_Vocals_1.zip | 2025-05-29 12:01 | 28M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Okay_Okay_-_Vocals_2.zip | 2025-05-29 12:01 | 27M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Okay_You_Win_(Just_for_Now)_1.mp3 | 2018-07-08 13:22 | 3.6M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Okay_You_Win_(Just_for_Now)_1.svg | 2018-07-08 13:46 | 8.8K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Once_I_Went_You_-_Vocals_Ukulele_Banjo_Acoustic_Guitar_(Kara_Square).mp3 | 2012-04-26 22:21 | 4.7M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Once_I_Went_You_-_Vocals_Ukulele_Banjo_Acoustic_Guitar_(Kara_Square).svg | 2016-09-02 21:35 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Once_I_Went_You_-_Vocals_Ukulele_Banjo_Acoustic_Guitar_(Kara_Square).zip | 2012-03-01 21:08 | 11M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Once_I_Went_You_-_Vocals_Ukulele_Banjo_Acoustic_Guitar_(Kara_Square)_2.zip | 2012-03-01 21:14 | 25M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_One-Two-Three_(Vocals).mp3 | 2014-01-24 23:18 | 4.6M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_One-Two-Three_(Vocals).svg | 2016-01-19 15:42 | 8.6K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_One-Two-Three_(Vocals).zip | 2014-01-24 23:14 | 22M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Optimistic_Ukulele_and_Tuba_Soiree.mp3 | 2014-06-04 01:10 | 2.9M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Optimistic_Ukulele_and_Tuba_Soiree.svg | 2016-09-02 21:29 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Optimistic_Ukulele_and_Tuba_Soiree.zip | 2014-05-31 13:15 | 18M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Optimistic_Ukulele_and_Tuba_Soiree_2.zip | 2014-05-31 13:20 | 47M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Our_Last_Christmas_(Sing-along).flac | 2012-10-26 12:57 | 6.9M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Our_Last_Christmas_(Sing-along).mp3 | 2011-12-23 20:32 | 1.9M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Our_Last_Christmas_(Sing-along).svg | 2016-12-13 17:20 | 8.8K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Our_Last_Christmas_(Sing-along).zip | 2011-12-23 20:21 | 8.3M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Out_There_Somewhere_(Vocals).mp3 | 2015-01-22 19:30 | 5.5M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Out_There_Somewhere_(Vocals).svg | 2018-03-21 15:29 | 8.4K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Out_There_Somewhere_(Vocals).zip | 2014-09-23 16:45 | 26M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Pathways_of_the_Mind.flac | 2014-07-18 15:05 | 24M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Pathways_of_the_Mind.mp3 | 2014-07-18 15:07 | 5.2M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Pathways_of_the_Mind.svg | 2016-01-04 06:08 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Pathways_of_the_Mind.zip | 2014-07-19 22:32 | 7.5M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Pathways_of_the_Mind_(Vocals).flac | 2016-07-26 17:24 | 3.9M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Pathways_of_the_Mind_(Vocals).mp3 | 2014-07-18 15:13 | 3.6M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Pathways_of_the_Mind_(Vocals).svg | 2017-07-31 14:11 | 8.5K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Pathways_of_the_Mind_(Vocals).zip | 2014-07-18 14:52 | 22M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Pathways_of_the_Mind_(Vocals)_1.flac | 2016-07-26 17:24 | 1.8M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Pathways_of_the_Mind_1.zip | 2014-07-19 22:35 | 27M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Pathways_of_the_Mind_2.zip | 2014-07-19 22:38 | 30M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Pathways_of_the_Mind_3.zip | 2014-07-19 22:41 | 27M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Pathways_of_the_Mind_4.zip | 2014-07-19 23:58 | 41M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Perfect_Storm.zip | 2020-06-22 14:32 | 24M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Perfect_Storm_1.mp3 | 2020-06-24 11:47 | 5.8M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Perfect_Storm_1.svg | 2020-06-24 15:37 | 8.5K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Perfect_Storm_1.zip | 2020-06-22 14:33 | 12M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Perfectly_for_You.mp3 | 2013-06-27 14:10 | 2.3M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Perfectly_for_You.svg | 2015-12-16 16:14 | 8.8K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Perfectly_for_You.zip | 2013-06-21 17:56 | 21M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Pheromones_-_Vocals_(Collaboration_with_Piero_Peluche).mp3 | 2013-07-25 19:39 | 4.2M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Pheromones_-_Vocals_(Collaboration_with_Piero_Peluche).svg | 2017-12-09 16:41 | 8.2K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Pheromones_-_Vocals_(Collaboration_with_Piero_Peluche).zip | 2013-07-25 15:15 | 21M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Piano_Triumph.mp3 | 2014-07-25 16:47 | 3.4M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Piano_Triumph.svg | 2015-12-19 07:24 | 8.8K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Piano_Triumph.zip | 2014-07-25 16:48 | 9.1M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Please_Don_t_Wish_Me_A_Merry_Christmas.flac | 2012-10-26 13:01 | 19M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Please_Don_t_Wish_Me_A_Merry_Christmas.mp3 | 2011-12-16 16:48 | 3.9M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Please_Don_t_Wish_Me_A_Merry_Christmas.svg | 2021-08-16 07:38 | 8.8K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Please_Don_t_Wish_Me_A_Merry_Christmas.zip | 2011-12-02 22:51 | 43M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Please_Don_t_Wish_Me_A_Merry_Christmas_-_Vocals_Ukulele_Melodica.mp3 | 2012-04-06 14:47 | 6.4M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Please_Don_t_Wish_Me_A_Merry_Christmas_-_Vocals_Ukulele_Melodica.svg | 2015-12-15 22:18 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Please_Don_t_Wish_Me_A_Merry_Christmas_-_Vocals_Ukulele_Melodica.zip | 2011-12-02 22:26 | 28M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Please_Don_t_Wish_Me_A_Merry_Christmas_-_Vocals_Ukulele_Melodica_1.zip | 2011-12-02 22:30 | 7.4M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Please_Don_t_Wish_Me_A_Merry_Christmas_1.zip | 2011-12-02 22:58 | 28M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Please_Don_t_Wish_Me_A_Merry_Christmas_2.zip | 2011-12-02 23:02 | 7.4M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Plucked_Contemporary_Boom.mp3 | 2013-10-27 22:00 | 4.8M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Plucked_Contemporary_Boom.svg | 2017-02-17 06:52 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Pollinators.flac | 2022-06-05 15:16 | 33M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Pollinators.mp3 | 2022-07-11 17:23 | 3.9M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Pollinators.svg | 2022-07-13 16:17 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Pollinators_-_Vocals.mp3 | 2022-06-05 15:22 | 3.9M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Pollinators_-_Vocals.svg | 2022-06-05 20:26 | 8.8K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Pollinators_-_Vocals.zip | 2022-06-05 15:23 | 26M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Pollinators_-_Vocals_1.zip | 2022-06-05 15:24 | 28M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Pollinators_1.svg | 2022-06-07 09:18 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Polydactyl_Super_Cat_-_Vocals_Bass_Synth.mp3 | 2012-04-06 15:08 | 2.4M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Polydactyl_Super_Cat_-_Vocals_Bass_Synth.svg | 2018-06-30 22:51 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Polydactyl_Super_Cat_-_Vocals_Bass_Synth.zip | 2011-02-04 17:32 | 14M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Polydactyl_Super_Cat_-_Vocals_Bass_Synth_1.zip | 2011-02-04 17:40 | 14M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Positively_Uplifting_Piano.flac | 2016-03-11 20:49 | 4.6M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Positively_Uplifting_Piano.mp3 | 2016-03-11 20:48 | 1.6M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Positively_Uplifting_Piano.svg | 2017-01-02 22:37 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Positively_Uplifting_Piano.zip | 2016-03-11 20:50 | 21M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Possibility.flac | 2020-05-24 23:47 | 42M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Possibility.mp3 | 2020-05-24 23:45 | 5.0M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Possibility.svg | 2020-05-25 00:39 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Possibility_-_Vocals.flac | 2020-05-24 23:15 | 12M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Possibility_-_Vocals.mp3 | 2020-05-24 23:12 | 4.6M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Possibility_-_Vocals.svg | 2020-05-25 03:28 | 8.2K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Possibility_-_Vocals_1.flac | 2020-05-24 23:23 | 10M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Power_of_the_People.mp3 | 2016-12-13 00:07 | 3.4M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Power_of_the_People.svg | 2017-08-13 12:55 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Power_of_the_People_-_Vocals.mp3 | 2016-12-13 00:08 | 3.2M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Power_of_the_People_-_Vocals.svg | 2018-01-10 15:29 | 8.7K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Power_of_the_People_-_Vocals.zip | 2016-12-13 00:00 | 16M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Power_to_Strike.flac | 2011-04-15 12:50 | 28M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Power_to_Strike.mp3 | 2011-04-14 19:02 | 11M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Power_to_Strike.svg | 2019-04-13 08:33 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Power_to_Strike_-_Vocal_Stems.mp3 | 2012-04-12 20:16 | 10M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Power_to_Strike_-_Vocal_Stems.svg | 2017-11-09 21:44 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Power_to_Strike_-_Vocal_Stems.zip | 2011-04-14 18:45 | 33M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Primordial_Ocean_Dreams_1.svg | 2022-06-15 22:48 | 8.9K | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Primordial_Ocean_Dreams_Meditation.svg | 2022-06-16 23:09 | 8.9K | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Primordial_Ocean_Dreams_Meditation_1.svg | 2022-06-16 13:41 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Promise_Me_Nine.flac | 2025-10-26 13:20 | 12M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Promise_Me_Nine.mp3 | 2025-10-26 13:18 | 3.5M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Pulse_of_the_Party.svg | 2016-06-30 02:22 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Pulse_of_the_Party_1.flac | 2014-11-16 15:46 | 24M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Pulse_of_the_Party_1.mp3 | 2018-05-03 21:43 | 5.4M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Pulse_of_the_Party_1.svg | 2020-09-19 09:24 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Purring_Cat.flac | 2015-02-28 18:15 | 3.7M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Purring_Cat.mp3 | 2015-03-11 15:20 | 768K | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Purring_Cat.svg | 2016-01-01 20:21 | 9.1K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Recall.mp3 | 2013-07-21 16:39 | 7.5M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Recall.svg | 2016-07-27 01:39 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Recall_-_Vocals.mp3 | 2013-07-21 16:38 | 7.0M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Recall_-_Vocals.svg | 2017-08-01 10:29 | 8.6K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Recall_-_Vocals.zip | 2013-07-21 16:35 | 36M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Resolution_Don_t.mp3 | 2012-04-06 15:09 | 2.0M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Resolution_Don_t.svg | 2016-01-14 16:52 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Resolution_Don_t.zip | 2010-12-03 18:22 | 3.8M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Resolution_Don_t_EXTENDED.mp3 | 2012-04-06 15:11 | 4.9M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Resolution_Don_t_EXTENDED.svg | 2016-01-14 02:38 | 8.8K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Resolution_Don_t_EXTENDED.zip | 2010-12-03 18:53 | 18M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Rise_Up_and_Remember.mp3 | 2012-04-30 17:43 | 7.4M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Rise_Up_and_Remember.svg | 2017-03-16 14:08 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Rise_Up_and_Remember_-_VOCALS.mp3 | 2012-04-30 17:45 | 7.1M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Rise_Up_and_Remember_-_VOCALS.svg | 2016-11-07 22:08 | 8.3K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Rise_Up_and_Remember_-_VOCALS.zip | 2012-01-22 21:45 | 18M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Rise_Up_and_Remember_1.mp3 | 2012-04-30 17:43 | 7.4M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Rise_to_New_Heights_-_Ukulele_Parts.mp3 | 2013-12-08 17:21 | 2.0M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Rise_to_New_Heights_-_Ukulele_Parts.svg | 2016-07-11 21:51 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Rise_to_New_Heights_-_Ukulele_Parts.zip | 2013-12-08 17:19 | 14M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Scar_-_Vocals.mp3 | 2011-08-27 02:18 | 6.6M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Scar_-_Vocals.svg | 2015-12-28 18:02 | 8.5K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Scar_-_Vocals.zip | 2011-08-26 20:48 | 17M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Scars.mp3 | 2012-02-19 14:14 | 5.0M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Scars.svg | 2018-01-04 12:24 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Scars.zip | 2012-02-19 13:42 | 22M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Scars_1.zip | 2012-02-19 13:51 | 25M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Scars_2.zip | 2012-02-19 13:56 | 29M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Scars_3.zip | 2012-02-19 14:02 | 27M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Scars_5.zip | 2012-02-19 13:45 | 14M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Severed_Roots_-_Vocals.flac | 2020-12-13 15:05 | 11M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Severed_Roots_-_Vocals_1.mp3 | 2020-12-13 15:06 | 5.3M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Severed_Roots_-_Vocals_1.svg | 2020-12-13 16:02 | 8.2K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Severed_Roots_-_Vocals_2.flac | 2020-12-13 15:05 | 29M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Severed_Roots_1.flac | 2020-12-13 14:58 | 25M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Severed_Roots_1.mp3 | 2020-12-13 15:09 | 6.1M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Severed_Roots_1.svg | 2020-12-13 16:11 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Shape_Shifting_Aliens.mp3 | 2011-07-28 17:15 | 11M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Shape_Shifting_Aliens.svg | 2016-03-09 19:48 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Shape_Shifting_Aliens.zip | 2011-07-28 16:37 | 24M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Shape_Shifting_Aliens_-_Vocals_and_Otamatone.svg | 2018-01-06 21:38 | 8.8K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Shape_Shifting_Aliens_-_Vocals_and_Otamatone_1.mp3 | 2024-07-03 17:58 | 10M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Shape_Shifting_Aliens_-_Vocals_and_Otamatone_1.svg | 2024-07-04 03:14 | 8.8K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Shape_Shifting_Aliens_1.zip | 2011-07-28 16:39 | 8.4M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Shape_Shifting_Aliens_2.zip | 2011-07-28 16:49 | 42M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Shifting_Seasons_(Mother_Truckers).flac | 2017-08-11 23:02 | 4.4M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Shifting_Seasons_(Mother_Truckers).mp3 | 2017-09-10 05:55 | 1.4M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Shifting_Seasons_(Mother_Truckers).svg | 2018-04-01 19:07 | 8.6K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Silly_Monkey.mp3 | 2011-03-27 13:12 | 5.7M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Silly_Monkey.svg | 2016-07-30 21:00 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Sixeight_03.flac | 2025-07-25 18:14 | 15M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Sixeight_03.mp3 | 2025-07-25 18:13 | 2.2M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Sixeight_03.svg | 2025-08-27 18:00 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Sixeight_03.zip | 2025-07-25 18:15 | 16M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Sleep_Sleep_Sleep_(Polydactyl_Super_Cat_Lullaby)_-_Vocals_Uke_Bass_Bells.mp3 | 2013-12-05 19:42 | 5.8M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Sleep_Sleep_Sleep_(Polydactyl_Super_Cat_Lullaby)_-_Vocals_Uke_Bass_Bells.svg | 2016-07-15 10:33 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Sleep_Sleep_Sleep_(Polydactyl_Super_Cat_Lullaby)_-_Vocals_Uke_Bass_Bells.zip | 2013-12-05 19:20 | 25M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Sleep_Sleep_Sleep_(Polydactyl_Super_Cat_Lullaby)_-_Vocals_Uke_Bass_Bells_1.zip | 2013-12-05 19:31 | 37M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Sleep_Sleep_Sleep_(Polydactyl_Super_Cat_Lullaby)_-_Vocals_Uke_Bass_Bells_2.zip | 2013-12-05 19:37 | 33M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Sleep_Sleep_Sleep_(Polydactyl_Super_Cat_Lullaby)_-_Vocals_Uke_Bass_Bells_4.zip | 2013-12-05 19:26 | 39M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Something_Right_-_Vocals_Ukulele_and_Claps.mp3 | 2012-11-08 21:38 | 3.9M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Something_Right_-_Vocals_Ukulele_and_Claps.svg | 2016-11-16 17:57 | 8.8K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Something_Right_-_Vocals_Ukulele_and_Claps.zip | 2012-11-08 21:06 | 16M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Something_Right_-_Vocals_Ukulele_and_Claps_1.zip | 2012-11-08 21:13 | 14M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Spinning.zip | 2011-09-23 18:15 | 48M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Spinning_-_Vocal_Stems.mp3 | 2016-08-15 11:46 | 4.5M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Spinning_-_Vocal_Stems.svg | 2016-11-11 23:54 | 8.8K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Spinning_-_Vocal_Stems.zip | 2011-09-23 18:38 | 15M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Spinning_-_Vocal_Stems_1.zip | 2011-09-23 18:49 | 42M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Spinning_1.mp3 | 2011-09-23 19:17 | 5.5M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Spinning_1.svg | 2016-06-28 12:01 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Spinning_2.zip | 2011-09-23 18:23 | 30M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Spirited_8-Bit_March.mid | 2014-12-11 23:56 | 8.6K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Spirited_8-Bit_March.mp3 | 2014-12-12 00:02 | 2.3M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Spirited_8-Bit_March.svg | 2016-02-19 04:11 | 9.0K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Spirited_8-Bit_March.zip | 2014-12-11 23:57 | 17M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Spirited_8-Bit_March_2.zip | 2014-12-11 23:59 | 23M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Spirits_of_the_Dead.flac | 2017-10-31 12:21 | 34M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Spirits_of_the_Dead.mp3 | 2017-11-04 14:52 | 4.4M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Spirits_of_the_Dead.svg | 2018-02-06 16:07 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Spirits_of_the_Dead_-_Vocals.flac | 2017-10-31 12:28 | 10M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Spirits_of_the_Dead_-_Vocals.mp3 | 2017-10-31 12:24 | 4.4M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Spirits_of_the_Dead_-_Vocals.svg | 2018-04-01 12:25 | 8.2K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Spirits_of_the_Dead_-_Vocals_1.flac | 2017-10-31 12:29 | 13M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Spirits_of_the_Dead_1.svg | 2017-11-01 20:05 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Spring_Death_-_Vocals.zip | 2021-06-14 16:22 | 35M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Spring_Death_-_Vocals_1.mp3 | 2021-06-14 16:21 | 4.6M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Spring_Death_-_Vocals_1.svg | 2021-06-14 16:58 | 8.3K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Start_Each_Day_with_Love_-_Vocals_and_Ukulele_(Kara_Square).flac | 2016-07-26 17:14 | 4.8M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Start_Each_Day_with_Love_-_Vocals_and_Ukulele_(Kara_Square).mp3 | 2012-04-06 14:24 | 8.2M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Start_Each_Day_with_Love_-_Vocals_and_Ukulele_(Kara_Square).svg | 2018-03-23 21:13 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Start_Each_Day_with_Love_-_Vocals_and_Ukulele_(Kara_Square).zip | 2012-02-03 16:38 | 25M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Start_Each_Day_with_Love_-_Vocals_and_Ukulele_(Kara_Square)_1.flac | 2016-07-26 17:15 | 2.2M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Stayin_at_Home_(feat._Duckett).svg | 2020-04-05 15:13 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Stayin_at_Home_(feat._Duckett)_1.flac | 2020-04-05 14:29 | 18M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Stayin_at_Home_(feat._Duckett)_1.mp3 | 2020-04-05 17:18 | 3.8M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Stayin_at_Home_(feat._Duckett)_1.svg | 2020-08-13 05:33 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Stayin_at_Home_-_Vocals.zip | 2020-04-05 14:41 | 7.3M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Stayin_at_Home_-_Vocals_1.mp3 | 2020-04-05 17:18 | 3.6M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Stayin_at_Home_-_Vocals_1.svg | 2020-04-05 17:21 | 8.3K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Stayin_at_Home_-_Vocals_2.zip | 2020-04-05 14:39 | 18M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Stayin_at_Home_1.svg | 2020-04-05 14:30 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Stems-_Banjo_the_Ferret_Song.mp3 | 2012-04-06 15:16 | 4.6M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Stems-_Banjo_the_Ferret_Song.svg | 2015-12-14 17:43 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Stems-_Banjo_the_Ferret_Song.zip | 2010-08-20 16:01 | 32M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Stems-_Banjo_the_Ferret_Song_1.zip | 2010-08-20 16:22 | 35M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Stems-_Head_in_the_Clouds.mp3 | 2012-04-06 15:26 | 878K | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Stems-_Head_in_the_Clouds.svg | 2016-03-02 16:13 | 9.1K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Stems-_Head_in_the_Clouds.zip | 2010-07-01 19:42 | 29M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Stems-_How_Do_Lesbians_Have_Sex_.mp3 | 2020-04-20 16:35 | 3.5M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Stems-_How_Do_Lesbians_Have_Sex_.svg | 2020-04-30 20:59 | 8.8K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Stems-_How_Do_Lesbians_Have_Sex_1.zip | 2010-07-01 21:45 | 48M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Stems-_How_Do_Lesbians_Have_Sex_2.zip | 2010-07-01 21:04 | 45M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Stems-_Mosquitoes_Blood_on_Tap.mp3 | 2012-04-06 15:23 | 1.5M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Stems-_Mosquitoes_Blood_on_Tap.svg | 2015-12-16 16:55 | 9.0K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Stems-_Mosquitoes_Blood_on_Tap.zip | 2010-07-08 20:26 | 17M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Stems-_Mosquitoes_Blood_on_Tap_1.zip | 2010-07-08 20:39 | 11M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Still_Stuck_(Vocals_Guitar_Clapping).mp3 | 2014-07-28 13:24 | 8.1M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Still_Stuck_(Vocals_Guitar_Clapping).svg | 2015-12-15 21:00 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Still_Stuck_(Vocals_Guitar_Clapping).zip | 2011-03-10 17:45 | 38M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Still_Stuck_(Vocals_Guitar_Clapping)_2.mp3 | 2014-07-28 13:24 | 10M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Still_Stuck_(Vocals_Guitar_Clapping)_2.svg | 2016-02-20 11:10 | 8.7K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Super_Power_Breastfeeding.mp3 | 2012-01-06 14:18 | 7.1M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Super_Power_Breastfeeding.svg | 2017-11-09 20:51 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Super_Power_Breastfeeding.zip | 2012-01-06 13:23 | 25M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Super_Power_Breastfeeding_1.zip | 2012-01-06 13:29 | 42M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Super_Power_Breastfeeding_2.mp3 | 2012-01-06 14:18 | 7.2M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Super_Power_Breastfeeding_2.svg | 2015-12-15 21:33 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Super_Power_Breastfeeding_3.mp3 | 2012-01-06 14:18 | 7.2M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Super_Power_Breastfeeding_3.svg | 2015-12-15 21:31 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Talkin_Bout_the_Weather.flac | 2022-02-27 15:18 | 24M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Talkin_Bout_the_Weather.mp3 | 2022-02-27 15:17 | 3.1M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Talkin_Bout_the_Weather.svg | 2022-02-27 20:28 | 8.8K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_That_is_That.flac | 2019-11-05 15:05 | 8.3M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_That_is_That.mp3 | 2019-11-05 15:00 | 3.2M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_That_is_That.svg | 2019-11-05 18:32 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_That_is_That.zip | 2019-11-05 15:06 | 27M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_The_Beauty_of_Empathy.mp3 | 2014-09-29 22:53 | 8.2M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_The_Beauty_of_Empathy.svg | 2016-07-15 10:01 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_The_Beauty_of_Empathy.zip | 2014-09-29 23:46 | 23M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_The_Beauty_of_Empathy_1.zip | 2014-09-29 23:48 | 26M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_The_Beauty_of_Empathy_2.zip | 2014-09-29 23:52 | 26M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_The_Bout_of_Bass_and_Ukulele.mp3 | 2013-06-06 22:08 | 3.9M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_The_Bout_of_Bass_and_Ukulele.svg | 2016-07-15 01:00 | 8.8K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_The_Bout_of_Bass_and_Ukulele.zip | 2013-06-06 21:00 | 23M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_The_Company_We_Keep.flac | 2026-02-04 17:48 | 4.6M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_The_Company_We_Keep.mp3 | 2026-02-23 13:33 | 2.4M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_The_Company_We_Keep.svg | 2026-02-25 10:00 | 8.7K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_The_Company_We_Keep_1.flac | 2026-02-04 17:47 | 5.3M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_The_Company_We_Keep_1.mp3 | 2026-02-04 17:53 | 2.4M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_The_Company_We_Keep_1.svg | 2026-02-05 08:49 | 8.7K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_The_Company_We_Keep_2.flac | 2026-02-04 17:48 | 4.6M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_The_Company_We_Keep_2.mp3 | 2026-04-07 13:21 | 2.4M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_The_Company_We_Keep_2.svg | 2026-04-07 21:39 | 8.7K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_The_Company_We_Keep_3.flac | 2026-02-04 17:47 | 5.3M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_The_Golden_Door_SING-ALONG.flac | 2017-03-16 21:36 | 4.3M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_The_Golden_Door_SING-ALONG.mp3 | 2017-03-16 21:35 | 3.8M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_The_Golden_Door_SING-ALONG.svg | 2018-01-28 19:36 | 7.8K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_The_Great_Ukulele_Space_Spar.mp3 | 2013-08-22 15:05 | 4.1M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_The_Great_Ukulele_Space_Spar.svg | 2015-12-16 07:01 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_The_Great_Ukulele_Space_Spar.zip | 2013-08-22 14:47 | 34M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_The_Great_Ukulele_Space_Spar_2.zip | 2013-08-22 14:59 | 44M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_The_Heart_of_a_Star_-_Vocals.mp3 | 2018-03-11 13:10 | 4.9M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_The_Heart_of_a_Star_-_Vocals.svg | 2018-04-21 11:49 | 8.6K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_The_Heart_of_a_Star_-_Vocals.zip | 2018-03-11 13:12 | 32M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_The_Heart_of_a_Star_1.flac | 2018-03-11 13:07 | 21M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_The_Heart_of_a_Star_1.mp3 | 2018-03-11 13:11 | 5.0M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_The_Heart_of_a_Star_1.svg | 2018-03-12 21:24 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_The_Most_Generic_Thing.mp3 | 2012-08-28 18:17 | 4.4M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_The_Most_Generic_Thing.svg | 2016-07-08 06:57 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_The_Most_Generic_Thing.zip | 2012-08-09 19:13 | 33M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_The_Most_Generic_Thing_1.zip | 2012-08-09 19:19 | 30M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_The_Narrator.mp3 | 2012-11-28 21:40 | 5.9M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_The_Narrator.svg | 2018-04-26 08:18 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_The_Narrator_-_Vocal_Stems.mp3 | 2012-04-12 20:14 | 5.0M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_The_Narrator_-_Vocal_Stems.svg | 2016-11-24 17:54 | 8.8K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_The_Narrator_-_Vocal_Stems_1.mp3 | 2012-04-12 20:14 | 5.6M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_The_Narrator_-_Vocal_Stems_1.svg | 2015-12-28 18:04 | 8.4K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_The_Oregon_Trail.mp3 | 2012-11-28 21:36 | 6.4M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_The_Oregon_Trail.svg | 2016-07-08 21:56 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_The_Oregon_Trail.zip | 2011-11-20 13:51 | 35M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_The_Oregon_Trail_2.zip | 2011-11-20 13:55 | 18M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_The_Oregon_Trail_3.zip | 2011-11-20 13:58 | 11M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_The_Past_Attacked_-_Vocals.flac | 2021-01-18 20:55 | 7.9M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_The_Past_Attacked_-_Vocals_1.mp3 | 2021-01-18 20:56 | 5.2M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_The_Past_Attacked_-_Vocals_1.svg | 2021-01-18 20:58 | 8.4K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_The_Past_Attacked_-_Vocals_2.flac | 2021-01-18 20:54 | 8.7M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_The_Past_Attacked_1.flac | 2021-01-18 20:49 | 41M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_The_Past_Attacked_1.mp3 | 2021-01-18 20:57 | 5.4M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_The_Past_Attacked_1.svg | 2021-01-18 21:04 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_The_Point_Is_the_Chaos_-_Vocals.mp3 | 2025-02-23 17:38 | 2.9M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_The_Point_Is_the_Chaos_-_Vocals.svg | 2025-02-23 21:44 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_The_Point_Is_the_Chaos_-_Vocals.zip | 2025-02-23 17:41 | 17M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_The_Point_Is_the_Chaos_-_Vocals_1.zip | 2025-02-23 17:41 | 18M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_The_Point_Is_the_Chaos_1.flac | 2025-02-23 17:35 | 24M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_The_Point_Is_the_Chaos_1.mp3 | 2025-02-24 13:25 | 2.9M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_The_Point_Is_the_Chaos_1.svg | 2025-02-27 13:11 | 8.8K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_The_Rumble_of_Ukulele_and_Trombone.mp3 | 2013-05-10 14:50 | 2.7M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_The_Rumble_of_Ukulele_and_Trombone.svg | 2016-07-30 20:59 | 8.8K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_The_Rumble_of_Ukulele_and_Trombone.zip | 2013-05-10 14:41 | 21M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_The_Scuffle_of_Mouth_Sounds_and_the_Magnificent_Uke.mp3 | 2013-10-18 19:04 | 2.4M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_The_Scuffle_of_Mouth_Sounds_and_the_Magnificent_Uke.svg | 2017-12-15 04:58 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_The_Scuffle_of_Mouth_Sounds_and_the_Magnificent_Uke.zip | 2013-10-18 18:50 | 17M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_There_is_a_Gap.flac | 2017-10-25 19:26 | 33M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_There_is_a_Gap.mp3 | 2017-10-25 19:25 | 4.5M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_There_is_a_Gap.svg | 2018-01-28 03:44 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_There_is_a_Gap_1.flac | 2017-10-25 19:28 | 28M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_These_Years_and_Still_-_Vocals_and_Ukulele.mp3 | 2012-11-02 17:01 | 4.0M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_These_Years_and_Still_-_Vocals_and_Ukulele.svg | 2016-07-12 18:03 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_These_Years_and_Still_-_Vocals_and_Ukulele.zip | 2012-11-02 17:05 | 19M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_They_Are_Not_to_Be_Trusted.mp3 | 2014-03-23 14:57 | 3.4M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_They_Are_Not_to_Be_Trusted.svg | 2016-11-03 07:15 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Tick_Tock_Antique_Clock.flac | 2015-02-28 18:21 | 4.2M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Tick_Tock_Antique_Clock.mp3 | 2015-02-28 18:20 | 840K | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Tick_Tock_Antique_Clock.svg | 2015-12-15 05:57 | 9.0K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Tippety_Tip_Tip_Tiptoe_-_Vocals.zip | 2021-04-21 14:13 | 4.1M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Tippety_Tip_Tip_Tiptoe_-_Vocals_1.mp3 | 2021-04-21 14:47 | 4.5M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Tippety_Tip_Tip_Tiptoe_-_Vocals_1.svg | 2021-04-21 16:51 | 8.7K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Tippety_Tip_Tip_Tiptoe_-_Vocals_2.zip | 2021-04-21 14:13 | 18M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Tippety_Tip_Tip_Tiptoe_-_Vocals_3.zip | 2021-04-21 14:13 | 2.4M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Tippety_Tip_Tip_Tiptoe_1.flac | 2021-04-21 14:05 | 20M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Tippety_Tip_Tip_Tiptoe_1.mp3 | 2021-04-21 14:46 | 4.7M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Tippety_Tip_Tip_Tiptoe_1.svg | 2021-04-22 01:21 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_To_Be_-_Vocal_(Beat_Box_Style).mp3 | 2011-09-25 18:15 | 457K | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_To_Be_-_Vocal_(Beat_Box_Style).svg | 2016-02-08 21:17 | 9.1K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_To_Be_-_Vocal_(Beat_Box_Style).zip | 2011-09-25 17:43 | 4.5M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_To_Be_Sensitive.mp3 | 2013-04-19 21:26 | 4.7M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_To_Be_Sensitive.svg | 2018-04-15 16:08 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_To_Be_Sensitive.zip | 2013-04-19 21:20 | 23M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Too_Depressed_for_the_Ukulele_(Featuring_Friends).mp3 | 2013-09-13 15:18 | 6.2M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Too_Depressed_for_the_Ukulele_(Featuring_Friends).svg | 2018-03-27 10:25 | 8.8K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Too_Depressed_for_the_Ukulele_(Featuring_Friends).zip | 2013-09-13 14:04 | 31M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Too_Depressed_for_the_Ukulele_(Featuring_Friends)_1.zip | 2013-09-13 14:51 | 12M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Too_Depressed_for_the_Ukulele_(Featuring_Friends)_2.zip | 2013-09-13 14:57 | 15M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Too_Depressed_for_the_Ukulele_(Featuring_Friends)_3.zip | 2013-09-13 15:03 | 17M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Too_Depressed_for_the_Ukulele_(Featuring_Friends)_5.zip | 2013-09-13 14:12 | 38M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Too_Depressed_for_the_Ukulele_(Featuring_Friends)_6.zip | 2013-09-13 14:32 | 17M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Too_Depressed_for_the_Ukulele_(Featuring_Friends)_7.zip | 2013-09-13 14:40 | 47M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Too_Depressed_for_the_Ukulele_(Featuring_Friends)_8.zip | 2013-09-13 14:48 | 16M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Top_of_the_Mountain.svg | 2018-12-16 12:18 | 8.8K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Top_of_the_Mountain_1.flac | 2018-12-16 12:13 | 24M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Top_of_the_Mountain_1.mp3 | 2018-12-16 12:47 | 5.4M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Top_of_the_Mountain_1.svg | 2018-12-16 13:15 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Toyland.mp3 | 2018-12-04 15:24 | 4.5M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Toyland.svg | 2020-05-28 13:26 | 9.0K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Toyland.zip | 2018-12-04 15:25 | 38M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Toyland_1.zip | 2018-12-04 15:26 | 36M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Transitional_Speck-tacle.flac | 2019-05-12 12:49 | 18M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Transitional_Speck-tacle.mp3 | 2019-05-12 12:48 | 3.7M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Transitional_Speck-tacle.svg | 2019-05-12 13:39 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Transmutation.flac | 2017-09-10 15:20 | 33M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Transmutation.mp3 | 2017-09-10 15:19 | 4.0M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Transmutation.svg | 2017-09-10 15:37 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Truth_and_Fact_-_Vocals_Guitar_.mp3 | 2011-02-23 12:34 | 8.3M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Truth_and_Fact_-_Vocals_Guitar_.svg | 2016-07-10 07:35 | 8.8K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Truth_and_Fact_-_Vocals_Guitar_.zip | 2011-02-23 02:17 | 16M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Truth_and_Fact_-_Vocals_Guitar_2.mp3 | 2011-02-23 12:34 | 7.7M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Truth_and_Fact_-_Vocals_Guitar_2.svg | 2018-01-03 17:41 | 8.5K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Truth_and_Fact_-_Vocals_Guitar_3.mp3 | 2011-02-23 12:34 | 8.1M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Truth_and_Fact_-_Vocals_Guitar_3.svg | 2016-05-01 09:36 | 8.8K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Trying_Not_to_Break.flac | 2014-06-04 00:52 | 21M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Trying_Not_to_Break.mp3 | 2015-03-15 19:59 | 6.4M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Trying_Not_to_Break.svg | 2017-07-31 17:24 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Trying_Not_to_Break.zip | 2014-06-04 00:46 | 36M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Trying_Not_to_Break_1.zip | 2014-06-04 00:59 | 19M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Trying_Not_to_Break_3.zip | 2014-06-04 00:50 | 29M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Trying_Not_to_Break_4.zip | 2014-06-04 00:56 | 37M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Tumbling_Dice.mp3 | 2010-11-07 15:58 | 7.2M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Tumbling_Dice.svg | 2017-04-27 22:52 | 9.0K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Tumbling_Dice.zip | 2010-11-07 16:17 | 30M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Tumbling_Dice_1.zip | 2010-11-07 16:37 | 22M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Uke_Be_Groovy.flac | 2017-06-26 21:37 | 4.0M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Uke_Be_Groovy.mp3 | 2017-06-26 21:36 | 2.6M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Uke_Be_Groovy.svg | 2017-11-29 04:04 | 8.7K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Uke_to_Your_Heart_s_Content.flac | 2017-06-29 18:39 | 4.6M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Uke_to_Your_Heart_s_Content.mp3 | 2017-06-29 18:41 | 2.4M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Uke_to_Your_Heart_s_Content.svg | 2017-11-28 19:00 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Uke_to_Your_Heart_s_Content_1.flac | 2017-06-29 18:40 | 3.8M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Uke_to_Your_Heart_s_Content_3.flac | 2017-06-29 18:40 | 4.4M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Ukuambient_Noise.svg | 2016-06-28 14:31 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Ukuambient_Noise_1.mp3 | 2018-04-19 15:03 | 3.9M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Ukuambient_Noise_1.svg | 2018-04-19 17:02 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Ukulele_Vs._Kazoo_and_Whistle_Too.mp3 | 2013-02-11 02:28 | 2.7M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Ukulele_Vs._Kazoo_and_Whistle_Too.svg | 2016-07-15 03:55 | 8.8K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Ukulele_Vs._Kazoo_and_Whistle_Too.zip | 2013-02-11 02:27 | 17M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Ukulele_and_Trombone_Happily_Bopping_Along.svg | 2017-11-14 03:36 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Ukulele_and_Trombone_Happily_Bopping_Along_1.mp3 | 2019-01-23 21:47 | 2.3M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Ukulele_and_Trombone_Happily_Bopping_Along_1.svg | 2019-01-23 21:49 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Ukulele_and_Trombone_Happily_Bopping_Along_1.zip | 2015-01-16 17:16 | 24M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Unfed.flac | 2023-08-06 14:50 | 24M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Unfed.mp3 | 2023-08-06 14:49 | 2.9M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Unfed.svg | 2023-08-15 20:35 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Unfed.zip | 2023-08-08 16:35 | 17M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Unfed_1.zip | 2023-08-08 16:35 | 13M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Unfed_2.zip | 2023-08-08 16:36 | 12M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Unknown_(Vocals_Guitar).mp3 | 2011-07-22 23:14 | 7.6M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Unknown_(Vocals_Guitar).svg | 2016-01-14 02:37 | 8.8K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Unknown_(Vocals_Guitar).zip | 2011-07-22 12:54 | 42M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Up.mp3 | 2013-10-27 15:54 | 6.6M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Up.svg | 2016-07-24 19:04 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Up_-_Vocals.mp3 | 2013-10-27 15:53 | 5.6M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Up_-_Vocals.svg | 2018-02-10 16:10 | 8.2K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Up_-_Vocals.zip | 2013-10-27 15:51 | 6.1M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Up_in_Flames.svg | 2018-11-18 15:11 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Up_in_Flames_1.flac | 2018-11-18 14:40 | 49M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Up_in_Flames_1.mp3 | 2018-11-30 12:42 | 5.1M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Up_in_Flames_1.svg | 2018-11-30 21:23 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Up_on_the_Housetop.mp3 | 2019-12-11 13:09 | 3.8M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Up_on_the_Housetop.svg | 2019-12-11 14:20 | 8.8K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Up_on_the_Housetop.zip | 2019-12-11 12:52 | 33M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Up_on_the_Housetop_1.svg | 2019-12-11 13:07 | 8.8K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Vocal_Stem-_Caffeine_Love_Affair.mp3 | 2012-04-06 15:23 | 2.6M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Vocal_Stem-_Caffeine_Love_Affair.svg | 2018-01-01 04:04 | 8.8K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Vocal_Stem-_Dead_Flesh.mp3 | 2012-04-06 15:19 | 1.5M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Vocal_Stem-_Dead_Flesh.svg | 2016-04-03 08:34 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Vocal_Stem-_Fexting_(Fake_Texting).mp3 | 2012-04-06 15:20 | 1.9M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Vocal_Stem-_Fexting_(Fake_Texting).svg | 2015-12-28 18:05 | 8.5K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Vocal_Stem-_Our_Creative_Community_The_World.mp3 | 2012-04-06 15:18 | 8.0M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Vocal_Stem-_Our_Creative_Community_The_World.svg | 2015-12-16 19:50 | 8.4K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Vocal_Stems-_10_Years_and_Still_(Folk-Pop_Love_Song).mp3 | 2012-04-06 15:13 | 6.1M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Vocal_Stems-_10_Years_and_Still_(Folk-Pop_Love_Song).svg | 2018-06-30 22:43 | 8.6K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Vocal_Stems-_10_Years_and_Still_(Folk-Pop_Love_Song)_1.mp3 | 2012-04-06 15:13 | 6.1M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Vocal_Stems-_10_Years_and_Still_(Folk-Pop_Love_Song)_3.mp3 | 2012-04-06 15:13 | 6.1M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Vocal_Stems-_10_Years_and_Still_(Folk-Pop_Love_Song)_3.svg | 2016-01-30 02:25 | 8.5K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Vocal_Stems-_Happy_(Team_Smile_and_Nod).mp3 | 2011-09-09 18:43 | 7.3M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Vocal_Stems-_Happy_(Team_Smile_and_Nod).svg | 2016-08-15 22:56 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Vocal_Stems-_Happy_(Team_Smile_and_Nod)_1.mp3 | 2011-09-09 18:43 | 7.3M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Vocal_Stems-_Happy_(Team_Smile_and_Nod)_2.mp3 | 2011-09-09 18:43 | 7.3M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Vocal_Stems-_Happy_(Team_Smile_and_Nod)_3.mp3 | 2011-09-09 18:43 | 7.3M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Vocal_Stems-_Happy_(Team_Smile_and_Nod)_5.mp3 | 2011-09-09 18:43 | 7.3M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Vocal_Stems-_Happy_(Team_Smile_and_Nod)_5.svg | 2016-01-08 22:44 | 8.6K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Vocal_Stems-_Organ_Donor.mp3 | 2012-04-06 15:14 | 2.8M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Vocal_Stems-_Organ_Donor.svg | 2016-01-14 16:53 | 8.6K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Vocal_Stems-_Organ_Donor_1.mp3 | 2012-04-06 15:14 | 2.8M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Vocal_Stems-_Organ_Donor_1.svg | 2018-08-03 07:44 | 8.4K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Vocal_Stems-_Stagnant.mp3 | 2012-04-06 15:17 | 9.7M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Vocal_Stems-_Stagnant.svg | 2016-01-13 13:08 | 8.6K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Vocalology.mp3 | 2012-05-19 22:17 | 3.2M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Vocalology.svg | 2018-01-05 22:30 | 8.8K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Vocalology.zip | 2012-05-19 22:11 | 13M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Vox_Vs._Uke.mp3 | 2014-06-27 16:46 | 4.6M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Vox_Vs._Uke.svg | 2016-02-09 23:06 | 8.8K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Vox_Vs._Uke.zip | 2011-09-04 18:44 | 35M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Waking_Dream_of_Life_and_Light.flac | 2023-05-25 20:12 | 3.8M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Waking_Dream_of_Life_and_Light.mp3 | 2023-05-25 20:11 | 1.2M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Waking_Dream_of_Life_and_Light_1.flac | 2023-05-25 20:12 | 3.9M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_We_Are_More_(Backup_Vocals).flac | 2019-03-28 23:08 | 12M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_We_Are_More_(Backup_Vocals).mp3 | 2019-03-28 23:10 | 4.6M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_We_Are_More_(Backup_Vocals).svg | 2019-04-29 14:30 | 9.1K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_We_Are_More_(Backup_Vocals)_2.flac | 2019-03-28 23:07 | 9.8M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_We_Are_More_(Backup_Vocals)_3.flac | 2019-03-28 23:07 | 6.5M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_We_Cannot_Save_Her.flac | 2024-05-31 17:40 | 19M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_We_Cannot_Save_Her.mp3 | 2024-05-31 17:40 | 2.9M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_We_Cannot_Save_Her.svg | 2024-06-10 13:59 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_We_Give_We_Get.mp3 | 2012-12-13 20:59 | 4.8M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_We_Give_We_Get.svg | 2016-07-10 09:18 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_We_Give_We_Get_-_Vocals.mp3 | 2012-12-13 20:59 | 4.3M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_We_Give_We_Get_-_Vocals.svg | 2017-12-11 09:42 | 8.4K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_We_Made_the_Monsters.flac | 2017-10-19 20:14 | 24M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_We_Made_the_Monsters.mp3 | 2017-10-19 20:21 | 5.3M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_We_Made_the_Monsters.svg | 2018-05-18 17:29 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_We_Made_the_Monsters_1.zip | 2017-10-19 20:15 | 19M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_We_Made_the_Monsters_2.zip | 2017-10-19 20:16 | 25M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_We_Rise.zip | 2020-02-14 20:31 | 12M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_We_Rise_1.flac | 2020-02-14 20:14 | 34M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_We_Rise_1.mp3 | 2020-02-14 20:32 | 11M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_We_Rise_1.svg | 2020-02-14 20:41 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_We_Rise_2.zip | 2020-02-14 20:31 | 13M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_We_Stand_for_Net_Neutrality.flac | 2017-07-07 17:36 | 23M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_We_Stand_for_Net_Neutrality.mp3 | 2017-07-07 17:39 | 5.4M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_We_Stand_for_Net_Neutrality.svg | 2017-12-10 10:34 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_We_Stand_for_Net_Neutrality.zip | 2017-07-07 17:38 | 41M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Whacha_Lookin_At-_Vocals.mp3 | 2011-02-05 23:39 | 4.1M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Whacha_Lookin_At-_Vocals.svg | 2016-01-01 17:23 | 8.3K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Whacha_Lookin_At.mp3 | 2011-02-05 23:43 | 4.1M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Whacha_Lookin_At.svg | 2019-07-12 08:28 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_When_I_Look_Up_At_The_Sky.mp3 | 2014-07-31 20:51 | 11M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_When_I_Look_Up_At_The_Sky.svg | 2016-11-16 01:22 | 8.2K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_When_I_Look_Up_At_The_Sky.zip | 2012-09-20 13:47 | 14M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_When_the_Meteorologist_Predicts_Snow.mp3 | 2013-12-30 14:53 | 4.6M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_When_the_Meteorologist_Predicts_Snow.svg | 2016-01-10 19:28 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_When_the_Meteorologist_Predicts_Snow.zip | 2013-12-26 19:52 | 25M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_When_the_Meteorologist_Predicts_Snow_-_Vocals_and_Bass.mp3 | 2013-12-27 01:57 | 4.5M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_When_the_Meteorologist_Predicts_Snow_-_Vocals_and_Bass.svg | 2015-12-14 15:41 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_When_the_Meteorologist_Predicts_Snow_-_Vocals_and_Bass.zip | 2013-12-26 20:17 | 22M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_When_the_Meteorologist_Predicts_Snow_-_Vocals_and_Bass_1.zip | 2013-12-26 20:26 | 12M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_When_the_Sun_Hardly_Comes_Out.mp3 | 2015-12-23 00:57 | 4.4M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_When_the_Sun_Hardly_Comes_Out.svg | 2018-04-25 01:33 | 8.8K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_When_the_Sun_Hardly_Comes_Out.zip | 2015-12-23 00:51 | 27M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_When_the_Sun_Hardly_Comes_Out_1.zip | 2015-12-23 00:55 | 20M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_When_the_Sun_Hardly_Comes_Out_3.zip | 2015-12-23 00:52 | 18M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Where_the_Moon_Shines_Bright.svg | 2020-09-13 13:12 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Where_the_Moon_Shines_Bright_1.flac | 2020-09-13 12:58 | 30M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Where_the_Moon_Shines_Bright_1.mp3 | 2020-10-02 16:22 | 10M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Where_the_Moon_Shines_Bright_1.svg | 2020-10-26 10:02 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Who_Do_You_Believe_-_Vocals.flac | 2026-02-22 15:11 | 12M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Who_Do_You_Believe_-_Vocals_1.flac | 2026-02-22 15:11 | 110K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Who_Do_You_Believe_-_Vocals_1.mp3 | 2026-02-22 15:55 | 3.3M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Who_Do_You_Believe_-_Vocals_1.svg | 2026-02-25 10:00 | 8.6K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Who_Do_You_Believe_-_Vocals_3.flac | 2026-02-22 15:10 | 12M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Who_Do_You_Believe_.flac | 2026-02-22 15:08 | 32M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Who_Do_You_Believe_1.mp3 | 2026-02-22 15:56 | 3.7M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Who_s_the_Man_.mp3 | 2013-04-18 23:54 | 4.1M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Who_s_the_Man_.svg | 2018-05-01 21:54 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Who_s_the_Man_.zip | 2013-04-18 22:59 | 28M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Windfall_Fundraiser_Soundbite.flac | 2015-09-30 12:38 | 1.3M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Windfall_Fundraiser_Soundbite.mp3 | 2015-09-30 12:38 | 433K | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Windfall_Fundraiser_Soundbite.svg | 2016-07-15 12:12 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Windfall_Fundraiser_Soundbite.zip | 2015-09-30 12:39 | 3.2M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Winter_(Poem_by_Walter_de_la_Mare).flac | 2021-12-15 16:00 | 6.4M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Winter_(Poem_by_Walter_de_la_Mare).mp3 | 2021-12-15 16:08 | 2.0M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Winter_(Poem_by_Walter_de_la_Mare).svg | 2021-12-15 23:36 | 8.6K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Winter_Bells_Glimmer_and_Shimmer.mid | 2014-12-15 21:26 | 14K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Winter_Bells_Glimmer_and_Shimmer.mp3 | 2014-12-15 21:25 | 6.7M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Winter_Bells_Glimmer_and_Shimmer.svg | 2018-04-04 17:15 | 9.0K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Winter_Bells_Glimmer_and_Shimmer.zip | 2014-12-15 21:29 | 40M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Winter_Bells_Glimmer_and_Shimmer_1.zip | 2014-12-15 21:31 | 19M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Winter_Stars.flac | 2024-12-18 16:22 | 6.6M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Winter_Stars.mp3 | 2024-12-18 16:21 | 2.7M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Winter_Stars.svg | 2024-12-23 22:39 | 8.2K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Wooden_Flute_Melody.flac | 2011-05-27 17:06 | 3.3M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Wooden_Flute_Melody.mp3 | 2012-04-06 15:00 | 3.1M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Wooden_Flute_Melody.svg | 2016-01-27 21:06 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Xylophone_and_Ukulele_Rival_with_Their_Revelry.mp3 | 2014-02-20 18:41 | 3.5M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Xylophone_and_Ukulele_Rival_with_Their_Revelry.svg | 2016-05-24 19:18 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Xylophone_and_Ukulele_Rival_with_Their_Revelry.zip | 2014-02-20 18:43 | 28M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Yeah_I_Do.mid | 2015-09-22 16:38 | 8.0K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Yeah_I_Do.mp3 | 2015-09-29 19:25 | 10M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Yeah_I_Do.svg | 2017-12-10 21:30 | 9.0K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Yeah_I_Do.zip | 2015-09-22 16:31 | 23M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Yeah_I_Do_1.zip | 2015-09-22 16:38 | 19M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Yeah_I_Do_2.zip | 2015-09-22 16:39 | 20M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Yeah_I_Do_3.zip | 2015-09-22 16:40 | 24M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Yeah_I_Do_5.zip | 2015-09-22 16:33 | 23M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Yeah_I_Do_6.zip | 2015-09-22 16:37 | 36M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_You_Are_My_Home.flac | 2018-04-30 22:00 | 23M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_You_Are_My_Home.mp3 | 2018-05-01 12:57 | 5.8M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_You_Are_My_Home.svg | 2018-05-01 13:17 | 9.0K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_You_Are_My_Home.zip | 2018-04-30 22:10 | 41M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_You_Are_My_Home_2.zip | 2018-04-30 22:04 | 34M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_You_Are_My_Home_3.zip | 2018-04-30 22:07 | 31M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_You_Give_Me_The_Reason.mp3 | 2017-02-07 00:29 | 6.5M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_You_Give_Me_The_Reason.svg | 2021-11-24 19:42 | 9.0K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_You_Give_Me_The_Reason.zip | 2017-02-06 22:07 | 17M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_You_Give_Me_The_Reason_1.zip | 2017-02-06 22:08 | 20M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_You_Give_Me_the_Reason.svg | 2017-02-06 22:16 | 9.0K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_You_Help_Me_Take_It_In.mp3 | 2014-07-11 19:29 | 4.3M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_You_Help_Me_Take_It_In.svg | 2018-04-16 12:00 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_You_Help_Me_Take_It_In.zip | 2014-07-11 18:55 | 45M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_You_Help_Me_Take_It_In_1.zip | 2014-07-11 19:02 | 23M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_You_Help_Me_Take_It_In_2.zip | 2014-07-11 19:28 | 24M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_You_Help_Me_Take_It_In_4.zip | 2014-07-11 18:59 | 41M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_You_Matter_(Happy_Birthday).mp3 | 2012-04-06 14:34 | 1.2M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_You_Matter_(Happy_Birthday).svg | 2015-12-20 18:31 | 8.8K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_You_Matter_(Happy_Birthday).zip | 2011-12-23 14:49 | 25M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_You_Were_You.flac | 2019-11-08 13:42 | 2.6M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_You_Were_You.zip | 2019-11-08 13:38 | 31M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_You_Were_You_1.mp3 | 2024-09-24 17:13 | 4.0M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_You_Were_You_1.svg | 2024-10-08 18:09 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_You_Were_You_2.flac | 2019-11-08 13:41 | 3.1M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_You_Were_You_2.zip | 2019-11-08 13:37 | 37M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_You_and_I.mp3 | 2016-05-25 12:54 | 3.9M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_You_and_I.svg | 2018-04-04 03:55 | 8.9K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_You_and_I.zip | 2016-05-25 12:57 | 28M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Zombie_Love_I_Heart_Your_Brain.mp3 | 2012-07-23 15:54 | 4.8M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Zombie_Love_I_Heart_Your_Brain.svg | 2017-02-04 17:35 | 9.1K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Zombie_Love_I_Heart_Your_Brain_-_VOCALS.mp3 | 2012-07-23 15:54 | 4.5M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Zombie_Love_I_Heart_Your_Brain_-_VOCALS.svg | 2016-01-04 21:55 | 8.8K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Zombie_Love_I_Heart_Your_Brain_-_VOCALS.zip | 2012-07-20 21:36 | 11M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Zombies_Invade_Christmas.mid | 2014-12-04 21:05 | 18K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Zombies_Invade_Christmas.mp3 | 2014-12-05 15:24 | 9.5M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Zombies_Invade_Christmas.svg | 2015-12-15 12:08 | 9.0K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Zombies_Invade_Christmas.zip | 2014-12-04 21:09 | 45M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_Zombies_Invade_Christmas_1.zip | 2014-12-04 21:11 | 29M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Zombies_Invade_Christmas_2.mp3 | 2014-12-05 15:24 | 13M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Zombies_Invade_Christmas_2.svg | 2015-12-17 15:41 | 8.8K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Zombies_Invade_Christmas_3.mp3 | 2014-12-05 15:24 | 13M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Zombies_Invade_Christmas_3.svg | 2016-05-22 04:11 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Zombies_Invade_Christmas_4.mp3 | 2014-12-05 15:24 | 13M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Zombies_Invade_Christmas_4.svg | 2015-12-22 21:47 | 8.7K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_Zombies_Invade_Christmas_5.mp3 | 2014-12-05 15:24 | 13M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_Zombies_Invade_Christmas_5.svg | 2015-12-15 21:58 | 9.0K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_ccMixter_BIG_Summer_Music_Fest_PROMO.mp3 | 2014-05-30 23:07 | 522K | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_ccMixter_BIG_Summer_Music_Fest_PROMO.svg | 2015-12-16 14:35 | 8.8K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_ccMixter_BIG_Summer_Music_Fest_PROMO.zip | 2014-05-30 22:59 | 19M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_ccMixter_BIG_Summer_Music_Fest_PROMO_-_Long_Version.mp3 | 2014-05-31 13:34 | 3.1M | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_ccMixter_BIG_Summer_Music_Fest_PROMO_-_Long_Version.svg | 2015-12-25 11:40 | 9.0K | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_ccMixter_BIG_Summer_Music_Fest_PROMO_-_Long_Version.zip | 2014-05-31 01:19 | 49M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_ccMixter_BIG_Summer_Music_Fest_PROMO_-_Long_Version_1.mp3 | 2014-05-31 13:34 | 5.1M | |
![[ ]](/icons/compressed.gif) | mindmapthat_-_ccMixter_BIG_Summer_Music_Fest_PROMO_2.zip | 2014-05-30 23:03 | 49M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_ccMixter_Endurance_Promo.mp3 | 2019-11-01 23:32 | 694K | |
![[IMG]](/icons/image2.gif) | mindmapthat_-_ccMixter_Endurance_Promo.svg | 2019-11-02 01:55 | 8.9K | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_ccMixter_Endurance_Promo_1.flac | 2019-11-01 23:22 | 3.0M | |
![[SND]](/icons/sound2.gif) | mindmapthat_-_ccMixter_Endurance_Promo_2.flac | 2019-11-01 23:23 | 1.0M | |
![[IMG]](/icons/image2.gif) | mosCC.jpg | 2010-08-20 16:51 | 16K | |
![[ ]](/icons/unknown.gif) | mp3 from Waking Dream of Life and Light by Kara Square. | 2023-11-07 17:21 | 1.2M | |
![[ ]](/icons/unknown.gif) | mp3 from Waking Dream of Life and Light by Kara Square.mp3 | 2023-11-07 17:34 | 1.2M | |
![[IMG]](/icons/image2.gif) | mplusSquare.png | 2023-08-07 23:05 | 39K | |
![[IMG]](/icons/image2.gif) | organ1_0001-pola.jpg | 2010-08-05 16:09 | 15K | |
![[ ]](/icons/unknown.gif) | preview from She Dreams in Starlight (rmx) by unreal_dm.mp3 | 2024-03-28 13:32 | 5.6M | |
![[ ]](/icons/unknown.gif) | preview from The Dust Of Broken Homes by Radioontheshelf.mp3 | 2023-11-08 19:14 | 13M | |
![[ ]](/icons/unknown.gif) | preview from Uplifting Ending by SackJo22.mp3 | 2023-11-08 19:14 | 3.6M | |
![[ ]](/icons/unknown.gif) | preview from suddenlyfloating by martinsea.mp3 | 2024-01-24 16:34 | 3.1M | |
![[IMG]](/icons/image2.gif) | smMMT-hornPIC.jpg | 2011-02-18 22:32 | 15K | |
![[ ]](/icons/unknown.gif) | wordCloud | 2024-07-25 17:25 | 51K | |
![[ ]](/icons/unknown.gif) | wordCloudClicks | 2025-12-14 10:59 | 51 | |
|